(2S)-methyl 2-((((R)-2-amino-2-methyl-3-((4-(4-(p-tolyl)butanoyl)benzyl)oxy)propoxy)(phenoxy)phosphoryl)amino)propanoate

ID: ALA4096894

PubChem CID: 137653865

Max Phase: Preclinical

Molecular Formula: C32H41N2O7P

Molecular Weight: 596.66

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H](C)NP(=O)(OC[C@](C)(N)COCc1ccc(C(=O)CCCc2ccc(C)cc2)cc1)Oc1ccccc1

Standard InChI:  InChI=1S/C32H41N2O7P/c1-24-13-15-26(16-14-24)9-8-12-30(35)28-19-17-27(18-20-28)21-39-22-32(3,33)23-40-42(37,34-25(2)31(36)38-4)41-29-10-6-5-7-11-29/h5-7,10-11,13-20,25H,8-9,12,21-23,33H2,1-4H3,(H,34,37)/t25-,32+,42?/m0/s1

Standard InChI Key:  BVNHBASJIGILFN-LGHOEUKBSA-N

Molfile:  

     RDKit          2D

 42 44  0  0  0  0  0  0  0  0999 V2000
   22.6940   -3.7166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3339   -4.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4504   -5.3409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0982   -3.9262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2147   -5.0402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8546   -5.5505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7327   -6.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5850   -3.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5838   -4.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2919   -4.4518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0015   -4.0424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9987   -3.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2901   -2.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7099   -4.4499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7112   -5.2671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4170   -4.0402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1253   -4.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8324   -4.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5407   -4.4454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8772   -2.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1696   -3.2237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4618   -2.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7541   -3.2240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0463   -2.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7469   -2.4062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3387   -3.2243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6309   -2.8159    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   21.9233   -3.2247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6307   -1.9987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5376   -5.2633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2451   -5.6707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9532   -5.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9492   -4.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2412   -4.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6621   -5.6675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2155   -2.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2196   -1.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5126   -1.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8040   -2.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8069   -2.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5144   -3.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1226   -3.9749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
  1  2  1  0
  2  5  1  0
  5  3  2  0
  2  4  1  1
  6  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  8 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  1
 23 25  1  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 27  1  1  0
 19 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 19  1  0
 32 35  1  0
 28 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 23 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4096894

    ---

Associated Targets(Human)

Serum (1292 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 596.66Molecular Weight (Monoisotopic): 596.2651AlogP: 5.79#Rotatable Bonds: 17
Polar Surface Area: 126.18Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.33CX Basic pKa: 9.49CX LogP: 4.95CX LogD: 3.13
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.11Np Likeness Score: -0.29

References

1. James E, Pertusati F, Brancale A, McGuigan C..  (2017)  Kinase-independent phosphoramidate S1P1 receptor agonist benzyl ether derivatives.,  27  (6): [PMID:28236593] [10.1016/j.bmcl.2017.02.011]

Source