The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-methyl 2-((((R)-2-amino-2-methyl-3-((4-(4-(p-tolyl)butanoyl)benzyl)oxy)propoxy)(phenoxy)phosphoryl)amino)propanoate ID: ALA4096894
PubChem CID: 137653865
Max Phase: Preclinical
Molecular Formula: C32H41N2O7P
Molecular Weight: 596.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](C)NP(=O)(OC[C@](C)(N)COCc1ccc(C(=O)CCCc2ccc(C)cc2)cc1)Oc1ccccc1
Standard InChI: InChI=1S/C32H41N2O7P/c1-24-13-15-26(16-14-24)9-8-12-30(35)28-19-17-27(18-20-28)21-39-22-32(3,33)23-40-42(37,34-25(2)31(36)38-4)41-29-10-6-5-7-11-29/h5-7,10-11,13-20,25H,8-9,12,21-23,33H2,1-4H3,(H,34,37)/t25-,32+,42?/m0/s1
Standard InChI Key: BVNHBASJIGILFN-LGHOEUKBSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
22.6940 -3.7166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3339 -4.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4504 -5.3409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0982 -3.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2147 -5.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8546 -5.5505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7327 -6.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5850 -3.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5838 -4.0429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2919 -4.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0015 -4.0424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9987 -3.2197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2901 -2.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7099 -4.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7112 -5.2671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4170 -4.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1253 -4.4477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8324 -4.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5407 -4.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8772 -2.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1696 -3.2237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4618 -2.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7541 -3.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0463 -2.8156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7469 -2.4062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3387 -3.2243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6309 -2.8159 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
21.9233 -3.2247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6307 -1.9987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5376 -5.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2451 -5.6707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9532 -5.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9492 -4.4395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2412 -4.0358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6621 -5.6675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2155 -2.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2196 -1.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5126 -1.5911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8040 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8069 -2.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5144 -3.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1226 -3.9749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
1 2 1 0
2 5 1 0
5 3 2 0
2 4 1 1
6 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
8 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 1
23 25 1 0
24 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
27 1 1 0
19 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 19 1 0
32 35 1 0
28 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
23 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 596.66Molecular Weight (Monoisotopic): 596.2651AlogP: 5.79#Rotatable Bonds: 17Polar Surface Area: 126.18Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.33CX Basic pKa: 9.49CX LogP: 4.95CX LogD: 3.13Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.11Np Likeness Score: -0.29
References 1. James E, Pertusati F, Brancale A, McGuigan C.. (2017) Kinase-independent phosphoramidate S1P1 receptor agonist benzyl ether derivatives., 27 (6): [PMID:28236593 ] [10.1016/j.bmcl.2017.02.011 ]