tert-Butyl cis-3-[(hydroxyamino)carbonyl]-4-[({4-[(2-methylquinolin-4-yl)methoxy]phenyl}sulfonyl)amino]pyrrolidine-1-carboxylate

ID: ALA4096933

PubChem CID: 11855069

Max Phase: Preclinical

Molecular Formula: C27H32N4O7S

Molecular Weight: 556.64

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  Cc1cc(COc2ccc(S(=O)(=O)N[C@@H]3CN(C(=O)OC(C)(C)C)C[C@@H]3C(=O)NO)cc2)c2ccccc2n1

Standard InChI:  InChI=1S/C27H32N4O7S/c1-17-13-18(21-7-5-6-8-23(21)28-17)16-37-19-9-11-20(12-10-19)39(35,36)30-24-15-31(14-22(24)25(32)29-34)26(33)38-27(2,3)4/h5-13,22,24,30,34H,14-16H2,1-4H3,(H,29,32)/t22-,24+/m0/s1

Standard InChI Key:  NJDQLRBZXNPZKN-LADGPHEKSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    5.9582   -3.4791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3749   -4.1957    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.7872   -3.4766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2317   -3.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2306   -4.1856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9454   -4.5985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9436   -2.9454    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6590   -3.3546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6597   -4.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3750   -4.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0900   -4.1777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0853   -3.3476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3694   -2.9405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5172   -2.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9473   -5.4235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2339   -5.8376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5184   -5.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5211   -4.6025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8066   -4.1918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0920   -4.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0967   -5.4353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8118   -5.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6631   -4.6112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6661   -5.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0021   -5.9263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2599   -6.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0849   -6.7070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3369   -5.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2160   -5.6757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0400   -4.8698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6061   -6.2312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8200   -5.9807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5723   -7.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3925   -7.2833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2396   -8.1275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7270   -8.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3942   -9.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5471   -8.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1332   -9.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  4 14  1  0
  6 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20  2  1  0
  2 23  1  0
 24 23  1  6
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
 25 29  1  6
 29 30  2  0
 29 31  1  0
 31 32  1  0
 27 33  1  0
 33 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 36 38  1  0
 36 39  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4096933

   tert-butyl (3S,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-1-carboxylate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 556.64

Molecular Weight (Monoisotopic): 556.1992

AlogP: 3.14

#Rotatable Bonds: 7

Polar Surface Area: 147.16

Molecular Species: NEUTRAL

HBA: 8

HBD: 3

#RO5 Violations: 1

HBA (Lipinski): 11

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 8.83

CX Basic pKa: 5.02

CX LogP: 2.32

CX LogD: 2.31

Aromatic Rings: 3

Heavy Atoms: 39

QED Weighted: 0.30

Np Likeness Score: -1.18

References

1. Ouvry G, Berton Y, Bhurruth-Alcor Y, Bonnary L, Bouix-Peter C, Bouquet K, Bourotte M, Chambon S, Comino C, Deprez B, Duvert D, Duvert G, Hacini-Rachinel F, Harris CS, Luzy AP, Mathieu A, Millois C, Pascau J, Pinto A, Polge G, Reitz A, Reversé K, Rosignoli C, Taquet N, Hennequin LF..  (2017)  Identification of novel TACE inhibitors compatible with topical application.,  27  (8): [PMID:28274635] [10.1016/j.bmcl.2017.02.035]

Source

Source(1):

• Scientific Literature