9-((1-benzyl-1H-1,2,3-triazol-4-yl)methoxy)-7H-furo[3,2-g]chromen-7-one

ID: ALA4096955

PubChem CID: 137659912

Max Phase: Preclinical

Molecular Formula: C21H15N3O4

Molecular Weight: 373.37

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1ccc2cc3ccoc3c(OCc3cn(Cc4ccccc4)nn3)c2o1

Standard InChI:  InChI=1S/C21H15N3O4/c25-18-7-6-15-10-16-8-9-26-19(16)21(20(15)28-18)27-13-17-12-24(23-22-17)11-14-4-2-1-3-5-14/h1-10,12H,11,13H2

Standard InChI Key:  HZQLKZSXUXHMJN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
    2.6008   -1.0881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3130   -0.6808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0171   -1.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0171   -1.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3114   -2.3176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6008   -1.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8219   -2.1638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3377   -1.5021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8219   -0.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3114   -3.1326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0233   -3.5442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0233   -4.3633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6845   -4.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4305   -5.6221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6119   -5.6221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3579   -4.8443    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8380   -6.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6571   -6.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0690   -5.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8846   -5.6233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2923   -6.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8855   -7.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0671   -7.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7252   -2.3188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4333   -1.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4333   -1.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7252   -0.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1452   -2.3186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  1  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 13 12  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 12  1  0
 14 17  1  0
 17 18  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 18 23  1  0
  4 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
  3 27  1  0
 25 28  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4096955

    ---

Associated Targets(Human)

AGS (1999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 373.37Molecular Weight (Monoisotopic): 373.1063AlogP: 3.76#Rotatable Bonds: 5
Polar Surface Area: 83.29Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.36CX LogD: 3.36
Aromatic Rings: 5Heavy Atoms: 28QED Weighted: 0.44Np Likeness Score: -0.41

References

1. Shen QK, Liu CF, Zhang HJ, Tian YS, Quan ZS..  (2017)  Design and synthesis of new triazoles linked to xanthotoxin for potent and highly selective anti-gastric cancer agents.,  27  (21): [PMID:28947149] [10.1016/j.bmcl.2017.09.040]

Source