The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,4-difluorophenyl)-1,1-difluoro-3-(1H-tetrazol-1-yl)-1-(5-((4-(4-(trifluoromethyl)benzyloxy)phenyl)ethynyl)pyridin-2-yl)propan-2-ol ID: ALA4097031
PubChem CID: 89619334
Max Phase: Preclinical
Molecular Formula: C31H20F7N5O2
Molecular Weight: 627.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: OC(Cn1cnnn1)(c1ccc(F)cc1F)C(F)(F)c1ccc(C#Cc2ccc(OCc3ccc(C(F)(F)F)cc3)cc2)cn1
Standard InChI: InChI=1S/C31H20F7N5O2/c32-24-10-13-26(27(33)15-24)29(44,18-43-19-40-41-42-43)30(34,35)28-14-7-21(16-39-28)2-1-20-5-11-25(12-6-20)45-17-22-3-8-23(9-4-22)31(36,37)38/h3-16,19,44H,17-18H2
Standard InChI Key: MVPREMYBSOQZME-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
34.6605 -19.2907 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.6646 -20.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3702 -19.6957 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.9547 -20.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2429 -20.1120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9547 -21.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3784 -20.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2406 -21.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2402 -22.5733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9526 -22.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6668 -22.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6636 -21.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2429 -19.2907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9062 -18.8076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6536 -18.0263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8322 -18.0263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5757 -18.8077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9506 -19.7034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3759 -21.3471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.0869 -21.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7955 -21.3470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7929 -20.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0855 -20.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5066 -21.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2189 -22.1604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9313 -22.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9305 -23.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6420 -23.8018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3543 -23.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3506 -22.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6385 -22.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5342 -21.3420 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.9537 -23.8041 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.0635 -23.7941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.7697 -23.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4789 -23.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4776 -24.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1859 -25.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8931 -24.5983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8876 -23.7769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1787 -23.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6028 -25.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6068 -25.8206 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
45.3085 -24.5914 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
45.3046 -25.4113 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
4 5 1 0
4 6 1 0
2 7 1 0
6 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 6 1 0
5 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 13 1 0
4 18 1 0
7 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 7 1 0
24 25 3 0
21 24 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
8 32 1 0
10 33 1 0
29 34 1 0
34 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
39 42 1 0
42 43 1 0
42 44 1 0
42 45 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 627.52Molecular Weight (Monoisotopic): 627.1505AlogP: 6.02#Rotatable Bonds: 8Polar Surface Area: 85.95Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.66CX Basic pKa: 0.32CX LogP: 6.82CX LogD: 6.81Aromatic Rings: 5Heavy Atoms: 45QED Weighted: 0.17Np Likeness Score: -1.40
References 1. Yates CM, Garvey EP, Shaver SR, Schotzinger RJ, Hoekstra WJ.. (2017) Design and optimization of highly-selective, broad spectrum fungal CYP51 inhibitors., 27 (15): [PMID:28651982 ] [10.1016/j.bmcl.2017.06.037 ]