The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(4-Hydroxyphenyl)-2-(4-(morpholinomethyl)benzamido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxamide ID: ALA4097067
PubChem CID: 137660827
Max Phase: Preclinical
Molecular Formula: C27H29N3O4S
Molecular Weight: 491.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1c(NC(=O)c2ccc(CN3CCOCC3)cc2)sc2c1CCC(c1ccc(O)cc1)C2
Standard InChI: InChI=1S/C27H29N3O4S/c28-25(32)24-22-10-7-20(18-5-8-21(31)9-6-18)15-23(22)35-27(24)29-26(33)19-3-1-17(2-4-19)16-30-11-13-34-14-12-30/h1-6,8-9,20,31H,7,10-16H2,(H2,28,32)(H,29,33)
Standard InChI Key: KEHLUKQCBMRTHX-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
16.8803 -21.9610 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.1347 -21.1843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4717 -20.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4705 -19.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1776 -19.4753 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7622 -19.4775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9122 -20.9329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5188 -21.4805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2963 -21.2291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3478 -22.2796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8988 -21.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6757 -21.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8473 -20.7280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2359 -20.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4613 -20.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0631 -21.9610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8115 -21.1886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0212 -21.0213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4768 -21.6235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7285 -22.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5245 -22.5661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6245 -20.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2318 -21.0224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0576 -21.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6609 -22.3650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4397 -22.1164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.6118 -21.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0050 -20.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1839 -23.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3838 -22.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8371 -23.4364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0893 -24.2147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8933 -24.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4365 -23.7753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5432 -24.8226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16 1 1 0
1 2 1 0
2 3 2 0
3 17 1 0
3 4 1 0
4 5 1 0
4 6 2 0
2 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 9 1 0
16 17 2 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
13 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
20 29 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.61Molecular Weight (Monoisotopic): 491.1879AlogP: 3.91#Rotatable Bonds: 6Polar Surface Area: 104.89Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.23CX Basic pKa: 6.60CX LogP: 4.94CX LogD: 4.87Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.48Np Likeness Score: -1.37
References 1. Llona-Minguez S, Fayezi S, Alihemmati A, Juárez-Jiménez J, Piedrafita FJ, Helleday T.. (2017) Tetrahydrobenzothiophene carboxamides: Beyond the kinase domain and into the fatty acid realm., 27 (18): [PMID:28807439 ] [10.1016/j.bmcl.2017.08.006 ]