6-(4-Hydroxyphenyl)-2-(4-(morpholinomethyl)benzamido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxamide

ID: ALA4097067

PubChem CID: 137660827

Max Phase: Preclinical

Molecular Formula: C27H29N3O4S

Molecular Weight: 491.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)c1c(NC(=O)c2ccc(CN3CCOCC3)cc2)sc2c1CCC(c1ccc(O)cc1)C2

Standard InChI:  InChI=1S/C27H29N3O4S/c28-25(32)24-22-10-7-20(18-5-8-21(31)9-6-18)15-23(22)35-27(24)29-26(33)19-3-1-17(2-4-19)16-30-11-13-34-14-12-30/h1-6,8-9,20,31H,7,10-16H2,(H2,28,32)(H,29,33)

Standard InChI Key:  KEHLUKQCBMRTHX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   16.8803  -21.9610    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.1347  -21.1843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4717  -20.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4705  -19.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1776  -19.4753    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7622  -19.4775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9122  -20.9329    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5188  -21.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2963  -21.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3478  -22.2796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8988  -21.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6757  -21.5279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8473  -20.7280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2359  -20.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4613  -20.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0631  -21.9610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8115  -21.1886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0212  -21.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4768  -21.6235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7285  -22.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5245  -22.5661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6245  -20.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2318  -21.0224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0576  -21.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6609  -22.3650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4397  -22.1164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6118  -21.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0050  -20.7653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1839  -23.0017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3838  -22.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8371  -23.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0893  -24.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8933  -24.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4365  -23.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5432  -24.8226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 16  1  1  0
  1  2  1  0
  2  3  2  0
  3 17  1  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  2  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15  9  1  0
 16 17  2  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 13 22  1  0
 22 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 20 29  1  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4097067

    ---

Associated Targets(Human)

SCD Tchem Acyl-CoA desaturase (1011 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.61Molecular Weight (Monoisotopic): 491.1879AlogP: 3.91#Rotatable Bonds: 6
Polar Surface Area: 104.89Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 10.23CX Basic pKa: 6.60CX LogP: 4.94CX LogD: 4.87
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.48Np Likeness Score: -1.37

References

1. Llona-Minguez S, Fayezi S, Alihemmati A, Juárez-Jiménez J, Piedrafita FJ, Helleday T..  (2017)  Tetrahydrobenzothiophene carboxamides: Beyond the kinase domain and into the fatty acid realm.,  27  (18): [PMID:28807439] [10.1016/j.bmcl.2017.08.006]

Source