The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'-(4-fluorobenzylidene)-4-(1-(prop-2-yn-1-yl)-1H-benzo[d]imidazol-2-yl)benzohydrazide ID: ALA4097183
PubChem CID: 137662240
Max Phase: Preclinical
Molecular Formula: C24H17FN4O
Molecular Weight: 396.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C#CCn1c(-c2ccc(C(=O)N/N=C/c3ccc(F)cc3)cc2)nc2ccccc21
Standard InChI: InChI=1S/C24H17FN4O/c1-2-15-29-22-6-4-3-5-21(22)27-23(29)18-9-11-19(12-10-18)24(30)28-26-16-17-7-13-20(25)14-8-17/h1,3-14,16H,15H2,(H,28,30)/b26-16+
Standard InChI Key: WLPKXGNAOMBILK-WGOQTCKBSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
11.7648 -10.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7636 -10.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4785 -11.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4766 -9.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1920 -10.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1968 -10.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9887 -11.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4733 -10.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9808 -9.7555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2962 -10.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7122 -11.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5365 -11.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9456 -10.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5244 -9.6942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7016 -9.7023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7705 -10.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1882 -11.1141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1778 -9.6852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0131 -11.1080 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4204 -10.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2454 -10.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2311 -8.9694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0371 -8.7931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8435 -8.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6600 -11.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4842 -11.0915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8923 -10.3735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4702 -9.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6475 -9.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7173 -10.3664 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
13 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 2 0
20 21 1 0
9 22 1 0
22 23 1 0
23 24 3 0
21 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 21 1 0
27 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 396.43Molecular Weight (Monoisotopic): 396.1386AlogP: 4.24#Rotatable Bonds: 5Polar Surface Area: 59.28Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.30CX Basic pKa: 4.83CX LogP: 4.87CX LogD: 4.87Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: -2.06
References 1. Can ÖD, Osmaniye D, Demir Özkay Ü, Sağlık BN, Levent S, Ilgın S, Baysal M, Özkay Y, Kaplancıklı ZA.. (2017) MAO enzymes inhibitory activity of new benzimidazole derivatives including hydrazone and propargyl side chains., 131 [PMID:28301816 ] [10.1016/j.ejmech.2017.03.009 ]