2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 2-bromo-4-fluorobenzoate

ID: ALA4097214

PubChem CID: 137659667

Max Phase: Preclinical

Molecular Formula: C13H11BrFN3O4

Molecular Weight: 372.15

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccc(F)cc1Br

Standard InChI:  InChI=1S/C13H11BrFN3O4/c1-8-16-7-12(18(20)21)17(8)4-5-22-13(19)10-3-2-9(15)6-11(10)14/h2-3,6-7H,4-5H2,1H3

Standard InChI Key:  IRENTDLWVYDOSG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   35.1010  -18.5107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7554  -18.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4941  -17.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6744  -17.2579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4355  -18.0385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1111  -19.3279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5378  -18.2640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.1382  -17.7096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.7177  -19.0611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8238  -19.7277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8339  -20.5448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5466  -20.9446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5568  -21.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2492  -20.5272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6620  -18.3020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8534  -22.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8632  -22.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5765  -23.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2813  -22.9693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2681  -22.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5877  -24.2082    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.9684  -21.7332    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  5 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 13  1  0
 18 21  1  0
 20 22  1  0
M  CHG  2   7   1   9  -1
M  END

Alternative Forms

  1. Parent:

    ALA4097214

    ---

Associated Targets(non-human)

GUSB Beta-glucuronidase (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 372.15Molecular Weight (Monoisotopic): 370.9917AlogP: 2.86#Rotatable Bonds: 5
Polar Surface Area: 87.26Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.27CX LogP: 2.95CX LogD: 2.95
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.46Np Likeness Score: -1.94

References

1. Salar U, Khan KM, Taha M, Ismail NH, Ali B, Qurat-Ul-Ain, Perveen S, Ghufran M, Wadood A..  (2017)  Biology-oriented drug synthesis (BIODS): In vitro β-glucuronidase inhibitory and in silico studies on 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl aryl carboxylate derivatives.,  125  [PMID:27886546] [10.1016/j.ejmech.2016.11.031]

Source