The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-((1-(2-(naphthalen-2-ylamino)ethyl)piperidin-4-yl)methoxy)-N-(3-phenylpropyl)quinazolin-4-amine ID: ALA4097289
PubChem CID: 137658965
Max Phase: Preclinical
Molecular Formula: C35H39N5O
Molecular Weight: 545.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(CCCNc2ncnc3cc(OCC4CCN(CCNc5ccc6ccccc6c5)CC4)ccc23)cc1
Standard InChI: InChI=1S/C35H39N5O/c1-2-7-27(8-3-1)9-6-18-37-35-33-15-14-32(24-34(33)38-26-39-35)41-25-28-16-20-40(21-17-28)22-19-36-31-13-12-29-10-4-5-11-30(29)23-31/h1-5,7-8,10-15,23-24,26,28,36H,6,9,16-22,25H2,(H,37,38,39)
Standard InChI Key: UCPINSPKOMNEFD-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
25.4012 -28.1104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1191 -27.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1162 -26.8629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3994 -26.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6850 -27.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6873 -26.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9732 -26.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2564 -26.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2581 -27.6965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9727 -28.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3959 -25.6294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6783 -25.2175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9641 -25.6355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2465 -25.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5366 -25.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8221 -25.2293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1085 -25.6467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1115 -26.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8342 -26.8813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5449 -26.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5473 -28.1133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8305 -27.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1156 -28.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4005 -27.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6877 -28.1132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6855 -28.9394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4021 -29.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1211 -28.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9690 -29.3493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2537 -28.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5414 -29.3473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8261 -28.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3995 -28.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1145 -29.3467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8286 -28.1118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3980 -28.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1130 -27.6971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1149 -26.8757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4025 -26.4645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6868 -26.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6884 -27.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
4 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
9 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 35 2 0
36 33 1 0
33 34 2 0
34 32 1 0
37 35 1 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 545.73Molecular Weight (Monoisotopic): 545.3155AlogP: 7.03#Rotatable Bonds: 12Polar Surface Area: 62.31Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.99CX LogP: 6.54CX LogD: 4.94Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.16Np Likeness Score: -1.15
References 1. Halby L, Menon Y, Rilova E, Pechalrieu D, Masson V, Faux C, Bouhlel MA, David-Cordonnier MH, Novosad N, Aussagues Y, Samson A, Lacroix L, Ausseil F, Fleury L, Guianvarc'h D, Ferroud C, Arimondo PB.. (2017) Rational Design of Bisubstrate-Type Analogues as Inhibitors of DNA Methyltransferases in Cancer Cells., 60 (11): [PMID:28463515 ] [10.1021/acs.jmedchem.7b00176 ]