Acetic acid 1,2,3-trimethoxy-7-oxo-6,7-dihydro-5H-9-oxa-benzo[3,4]cyclohepta[1,2-f]inden-10-ylmethyl ester

ID: ALA4097664

PubChem CID: 137660625

Max Phase: Preclinical

Molecular Formula: C23H22O7

Molecular Weight: 410.42

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1cc2c(c(OC)c1OC)-c1cc3cc(COC(C)=O)oc3cc1C(=O)CC2

Standard InChI:  InChI=1S/C23H22O7/c1-12(24)29-11-15-7-14-8-17-16(10-19(14)30-15)18(25)6-5-13-9-20(26-2)22(27-3)23(28-4)21(13)17/h7-10H,5-6,11H2,1-4H3

Standard InChI Key:  BYMLZMDLURXSDW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   12.4834    0.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4823   -0.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1903   -0.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1886    1.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9020   -0.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8972    0.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5382    1.2832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3426    1.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7040    0.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3550   -0.3839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5547   -0.5725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3193   -1.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9173   -0.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6857   -1.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8850   -1.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8253   -2.7832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5892   -3.0942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1209   -2.4637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5211    0.3719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1907   -1.2945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4832   -1.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7743   -0.4764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0669   -0.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7756    1.1599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7754    1.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7849   -3.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1956   -4.4538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3913   -5.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8021   -5.8133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1763   -5.4744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  5  2  0
  6  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  5 11  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  0
 10 11  2  0
 11 12  1  0
 12 15  2  0
 14 13  2  0
 13 10  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  1  0
  9 19  2  0
  3 20  1  0
 20 21  1  0
  2 22  1  0
 22 23  1  0
  1 24  1  0
 24 25  1  0
 17 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA4097664

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 410.42

Molecular Weight (Monoisotopic): 410.1366

AlogP: 4.32

#Rotatable Bonds: 5

Polar Surface Area: 84.20

Molecular Species: NEUTRAL

HBA: 7

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): 7

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 2.76

CX LogD: 2.76

Aromatic Rings: 3

Heavy Atoms: 30

QED Weighted: 0.58

Np Likeness Score: 0.96

References

1. Gracheva IA, Voitovich IV, Faerman VI, Sitnikov NS, Myrsikova EV, Schmalz HG, Svirshevskaya EV, Fedorov AY..  (2017)  Synthesis and cytostatic properties of polyfunctionalized furanoallocolchicinoids.,  126  [PMID:27912174] [10.1016/j.ejmech.2016.11.020]

Source

Source(1):

• Scientific Literature