(E)-1,5-dimethyl-4-((2-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-3-yl)diazenyl)-2-phenyl-1,2-dihydro-3H-pyrazol-3-one

ID: ALA4097752

PubChem CID: 137660857

Max Phase: Preclinical

Molecular Formula: C24H21N7O

Molecular Weight: 423.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nn2c(-c3ccccc3)ccnc2c1/N=N/c1c(C)n(C)n(-c2ccccc2)c1=O

Standard InChI:  InChI=1S/C24H21N7O/c1-16-21(23-25-15-14-20(30(23)28-16)18-10-6-4-7-11-18)26-27-22-17(2)29(3)31(24(22)32)19-12-8-5-9-13-19/h4-15H,1-3H3/b27-26+

Standard InChI Key:  HMGAWCIFNUHAOC-CYYJNZCTSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   21.2938    0.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2927   -0.3606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0074   -0.7735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0057    0.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7211    0.4713    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7259   -0.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5134   -0.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9953    0.0687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5056    0.7364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7728   -1.3900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2244   -2.0062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4839   -2.7894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0032    1.7122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8202    0.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0054   -3.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4942   -4.1244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2774   -3.8649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2724   -3.0400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9368   -2.5509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1805   -3.4657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2438   -4.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9476   -4.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8610   -5.1673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5304   -5.6480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2830   -5.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3623   -4.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6918   -4.0055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7152    2.1177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7131    2.9434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9969    3.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2813    2.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2869    2.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  7 10  1  0
 10 11  2  0
 11 12  1  0
  4 13  1  0
  8 14  1  0
 12 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 12  1  0
 18 19  2  0
 15 20  1  0
 16 21  1  0
 17 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 13 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 13  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4097752

    ---

Associated Targets(non-human)

Ehrlich (1318 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.48Molecular Weight (Monoisotopic): 423.1808AlogP: 4.92#Rotatable Bonds: 4
Polar Surface Area: 81.84Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.01CX LogP: 3.63CX LogD: 3.63
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.38Np Likeness Score: -1.26

References

1. Cherukupalli S, Karpoormath R, Chandrasekaran B, Hampannavar GA, Thapliyal N, Palakollu VN..  (2017)  An insight on synthetic and medicinal aspects of pyrazolo[1,5-a]pyrimidine scaffold.,  126  [PMID:27894044] [10.1016/j.ejmech.2016.11.019]

Source