3-(17-Ethyl-3,12-dioxo-13-oxa-4,11-diaza-tricyclo[14.2.2.1(6,10)]henicosa-1(19),6,8,10(21),16(20),17-hexaen-2-ylamino)-benzamide

ID: ALA4097785

PubChem CID: 57842563

Max Phase: Preclinical

Molecular Formula: C27H28N4O4

Molecular Weight: 472.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1cc2ccc1CCOC(=O)Nc1cccc(c1)CNC(=O)C2Nc1cccc(C(N)=O)c1

Standard InChI:  InChI=1S/C27H28N4O4/c1-2-18-14-20-10-9-19(18)11-12-35-27(34)31-22-7-3-5-17(13-22)16-29-26(33)24(20)30-23-8-4-6-21(15-23)25(28)32/h3-10,13-15,24,30H,2,11-12,16H2,1H3,(H2,28,32)(H,29,33)(H,31,34)

Standard InChI Key:  ZUPUKEKKNTYECE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    4.7357  -10.9408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7341  -11.7221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4094  -12.1095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0870  -11.7214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0871  -10.9357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4068  -10.5494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7627  -12.1108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4407  -11.7182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1164  -12.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7903  -11.7150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4660  -12.1044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1399  -11.7160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8157  -12.1016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4889  -11.7141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4877  -10.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8090  -10.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1358  -10.9366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8030   -9.7637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1252   -9.3779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1234   -8.5959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7693   -8.0245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4317   -8.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4351   -9.3841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1116   -9.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1129  -10.5515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4389  -10.9403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7642  -10.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7579   -9.7789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4534   -9.7699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1141  -12.8855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0588  -12.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3845  -11.7205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0579  -12.8902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0477   -9.3747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0427   -8.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 22 21  1  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
  8 26  1  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
 19 29  2  0
  9 30  2  0
  2 31  1  0
 31 32  1  0
 31 33  2  0
 28 34  1  0
 34 35  1  0
M  END

Associated Targets(Human)

F7 Tchem Coagulation factor VII (948 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.55Molecular Weight (Monoisotopic): 472.2111AlogP: 3.92#Rotatable Bonds: 4
Polar Surface Area: 122.55Molecular Species: NEUTRALHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 12.53CX Basic pKa: 0.41CX LogP: 3.71CX LogD: 3.71
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: 0.28

References

1. Wurtz NR, Parkhurst BL, DeLucca I, Glunz PW, Jiang W, Zhang X, Cheney DL, Bozarth JM, Rendina AR, Wei A, Harper T, Luettgen JM, Wu Y, Wong PC, Seiffert DA, Wexler RR, Priestley ES..  (2017)  Neutral macrocyclic factor VIIa inhibitors.,  27  (12): [PMID:28460818] [10.1016/j.bmcl.2017.04.008]

Source