7-(Hydroxymethyl)-2-(4-(morpholinomethyl)phenyl)-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidin-4(3H)-one

ID: ALA4097790

PubChem CID: 137658735

Max Phase: Preclinical

Molecular Formula: C22H25N3O3S

Molecular Weight: 411.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1[nH]c(-c2ccc(CN3CCOCC3)cc2)nc2sc3c(c12)CCC(CO)C3

Standard InChI:  InChI=1S/C22H25N3O3S/c26-13-15-3-6-17-18(11-15)29-22-19(17)21(27)23-20(24-22)16-4-1-14(2-5-16)12-25-7-9-28-10-8-25/h1-2,4-5,15,26H,3,6-13H2,(H,23,24,27)

Standard InChI Key:  LVJAJQGONTZSAZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    6.2290   -5.7959    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.4526   -5.5407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4548   -4.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7563   -4.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0511   -4.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0489   -5.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7520   -5.9473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3397   -5.9430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6335   -5.5319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2339   -4.4725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7091   -5.1361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5169   -5.0569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8558   -4.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3807   -3.6514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5666   -3.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6653   -4.2369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1397   -4.9036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9524   -4.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2917   -4.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8123   -3.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0013   -3.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0899   -3.0658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1050   -4.0013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5807   -4.6658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2380   -5.4063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7101   -6.0690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5241   -5.9934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8639   -5.2492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3896   -4.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1 11  1  0
 10  3  1  0
  2  3  2  0
  2  7  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
 10 11  2  0
 10 15  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 13 16  1  0
 15 22  2  0
 19 23  1  0
 23 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4097790

    ---

Associated Targets(Human)

SCD Tchem Acyl-CoA desaturase (1011 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.53Molecular Weight (Monoisotopic): 411.1617AlogP: 2.58#Rotatable Bonds: 4
Polar Surface Area: 78.45Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.92CX Basic pKa: 6.75CX LogP: 2.56CX LogD: 2.61
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.69Np Likeness Score: -1.53

References

1. Llona-Minguez S, Fayezi S, Alihemmati A, Juárez-Jiménez J, Piedrafita FJ, Helleday T..  (2017)  Tetrahydrobenzothiophene carboxamides: Beyond the kinase domain and into the fatty acid realm.,  27  (18): [PMID:28807439] [10.1016/j.bmcl.2017.08.006]

Source