The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[123I]-N,N'-(5-iodo-1,3-phenylene)bis(2,3-dihydroxybenzamide) ID: ALA4097807
PubChem CID: 137659690
Max Phase: Preclinical
Molecular Formula: C20H15IN2O6
Molecular Weight: 506.25
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cc([123I])cc(NC(=O)c2cccc(O)c2O)c1)c1cccc(O)c1O
Standard InChI: InChI=1S/C20H15IN2O6/c21-10-7-11(22-19(28)13-3-1-5-15(24)17(13)26)9-12(8-10)23-20(29)14-4-2-6-16(25)18(14)27/h1-9,24-27H,(H,22,28)(H,23,29)/i21-4
Standard InChI Key: BTOXGIYRUMZGEV-PIRNEEEYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
34.8647 -3.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8636 -4.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5783 -5.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2948 -4.5893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2920 -3.7588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5765 -3.3497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5741 -2.5247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1501 -3.3501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0048 -3.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7209 -3.7534 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0017 -2.5186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4337 -3.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1482 -3.7515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8606 -3.3369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8579 -2.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1369 -2.1015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4274 -2.5183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5764 -3.7471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.2895 -3.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0053 -3.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2868 -2.5073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.0034 -4.5677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7184 -4.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4325 -4.5628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4272 -3.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7116 -3.3272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7055 -2.5023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.1388 -3.3162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.1309 -1.2765 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
1 8 1 0
5 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
14 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 20 1 0
26 27 1 0
25 28 1 0
16 29 1 0
M ISO 1 29 123
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.25Molecular Weight (Monoisotopic): 505.9975AlogP: 3.62#Rotatable Bonds: 4Polar Surface Area: 139.12Molecular Species: NEUTRALHBA: 6HBD: 6#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.78CX Basic pKa: ┄CX LogP: 3.87CX LogD: 3.71Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.24Np Likeness Score: -0.71