The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1S,2S,3R,4R,5S)-5-(4-Chloro-3-(4-ethoxybenzyl)phenyl)-1-cyclopropoxy-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol ID: ALA4097849
PubChem CID: 137661793
Max Phase: Preclinical
Molecular Formula: C24H27ClO7
Molecular Weight: 462.93
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc(Cc2cc([C@]34OC[C@](OC5CC5)(O3)[C@@H](O)[C@H](O)[C@H]4O)ccc2Cl)cc1
Standard InChI: InChI=1S/C24H27ClO7/c1-2-29-17-6-3-14(4-7-17)11-15-12-16(5-10-19(15)25)24-22(28)20(26)21(27)23(32-24,13-30-24)31-18-8-9-18/h3-7,10,12,18,20-22,26-28H,2,8-9,11,13H2,1H3/t20-,21-,22+,23-,24-/m0/s1
Standard InChI Key: UIWNXSSAMKJOET-LKTXNROYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
5.5658 -10.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5715 -11.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2676 -11.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9580 -11.2154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9524 -10.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2563 -10.0180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6939 -10.1031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7946 -9.3102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5360 -9.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1727 -9.4878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9101 -9.1782 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.0679 -10.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7046 -10.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4460 -10.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5508 -9.6654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2882 -9.3558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9249 -9.8431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6663 -9.5375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3030 -10.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0445 -9.7152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8242 -10.6360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0827 -10.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3305 -10.5905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9193 -9.6474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5658 -9.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6582 -11.6062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2773 -12.4215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8809 -11.6316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7861 -10.2275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2187 -10.8156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4304 -11.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0185 -11.6121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
5 7 1 1
7 8 2 0
9 8 1 0
10 9 2 0
10 11 1 0
12 10 1 0
12 13 1 0
13 14 1 0
14 15 2 0
16 15 1 0
17 16 2 0
17 18 1 0
18 19 1 0
19 20 1 0
21 17 1 0
22 21 2 0
14 22 1 0
23 12 2 0
7 23 1 0
5 24 1 0
25 24 1 0
1 25 1 0
4 26 1 6
3 27 1 1
2 28 1 6
1 29 1 1
29 30 1 0
31 30 1 0
32 31 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.93Molecular Weight (Monoisotopic): 462.1445AlogP: 2.50#Rotatable Bonds: 7Polar Surface Area: 97.61Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.79CX Basic pKa: ┄CX LogP: 4.00CX LogD: 4.00Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.58Np Likeness Score: 0.52
References 1. Li Y, Shi Z, Chen L, Zheng S, Li S, Xu B, Liu Z, Liu J, Deng C, Ye F.. (2017) Discovery of a Potent, Selective Renal Sodium-Dependent Glucose Cotransporter 2 (SGLT2) Inhibitor (HSK0935) for the Treatment of Type 2 Diabetes., 60 (10): [PMID:28447791 ] [10.1021/acs.jmedchem.6b01818 ]