3-Demethoxycarbonyl-3-(acetylamino)methyl vindoline

ID: ALA4097901

PubChem CID: 44178758

Max Phase: Preclinical

Molecular Formula: C26H35N3O5

Molecular Weight: 469.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@]12C=CCN3CC[C@@]4(c5ccc(OC)cc5N(C)[C@H]4[C@@](O)(CNC(C)=O)[C@@H]1OC(C)=O)[C@@H]32

Standard InChI:  InChI=1S/C26H35N3O5/c1-6-24-10-7-12-29-13-11-25(21(24)29)19-9-8-18(33-5)14-20(19)28(4)22(25)26(32,15-27-16(2)30)23(24)34-17(3)31/h7-10,14,21-23,32H,6,11-13,15H2,1-5H3,(H,27,30)/t21-,22+,23+,24+,25+,26-/m0/s1

Standard InChI Key:  RJEJNPYXHOZAJG-QHSXUUMZSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    6.9732   -7.6329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0066   -7.8795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7068   -6.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0524   -6.8752    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5148   -7.3890    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8992   -9.1198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7615   -8.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4184   -7.1645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7533   -7.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1324   -7.3269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8181   -6.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6373   -6.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4703   -9.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4688   -6.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7278   -9.7507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2978   -6.6491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1857   -7.8804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9137   -6.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7574   -9.5304    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1746   -6.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4897   -8.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4697   -7.4645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9784   -8.9646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6744   -8.2177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1857   -8.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8786   -7.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3359   -7.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8647   -9.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6817   -9.8451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0564   -9.8187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6079   -8.7130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3146   -9.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6100   -7.8958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0762  -10.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8932  -10.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6536  -11.2603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3 18  1  0
  5 20  1  0
 22 16  1  0
 21 23  1  0
 17  2  1  6
  2  8  1  0
 13 25  1  0
 21  1  2  0
  9 10  1  1
 27 24  2  0
 23 15  1  0
 17 26  1  0
 26  3  2  0
 23  7  1  0
 27  5  1  0
  7  9  1  0
 24 21  1  0
 22  4  1  6
 14 10  1  0
 11 27  1  0
 16 14  1  0
 16 18  1  0
  7 13  1  0
  7 19  1  1
  9  1  1  0
 12 11  2  0
 22 17  1  0
 25 17  1  0
  1 12  1  0
  9 22  1  0
 25  6  1  1
 13 28  1  6
 28 29  1  0
 13 30  1  0
  6 31  1  0
 31 32  1  0
 31 33  2  0
 29 34  1  0
 34 35  1  0
 34 36  2  0
M  END

Associated Targets(non-human)

MIN6 (162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.58Molecular Weight (Monoisotopic): 469.2577AlogP: 1.60#Rotatable Bonds: 5
Polar Surface Area: 91.34Molecular Species: BASEHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.81CX Basic pKa: 8.88CX LogP: 0.98CX LogD: -0.52
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: 1.68

References

1. Xiao C, Tian Y, Lei M, Chen F, Gan X, Yao X, Shen X, Chen J, Hu L..  (2017)  Synthesis and glucose-stimulate insulin secretion (GSIS) evaluation of vindoline derivatives.,  27  (5): [PMID:28162858] [10.1016/j.bmcl.2016.09.064]

Source