The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Demethoxycarbonyl-3-(acetylamino)methyl vindoline ID: ALA4097901
PubChem CID: 44178758
Max Phase: Preclinical
Molecular Formula: C26H35N3O5
Molecular Weight: 469.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@]12C=CCN3CC[C@@]4(c5ccc(OC)cc5N(C)[C@H]4[C@@](O)(CNC(C)=O)[C@@H]1OC(C)=O)[C@@H]32
Standard InChI: InChI=1S/C26H35N3O5/c1-6-24-10-7-12-29-13-11-25(21(24)29)19-9-8-18(33-5)14-20(19)28(4)22(25)26(32,15-27-16(2)30)23(24)34-17(3)31/h7-10,14,21-23,32H,6,11-13,15H2,1-5H3,(H,27,30)/t21-,22+,23+,24+,25+,26-/m0/s1
Standard InChI Key: RJEJNPYXHOZAJG-QHSXUUMZSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
6.9732 -7.6329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0066 -7.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7068 -6.3523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0524 -6.8752 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.5148 -7.3890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8992 -9.1198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7615 -8.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4184 -7.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7533 -7.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1324 -7.3269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8181 -6.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6373 -6.8827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4703 -9.1132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4688 -6.5646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7278 -9.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2978 -6.6491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1857 -7.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9137 -6.0913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7574 -9.5304 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.1746 -6.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4897 -8.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4697 -7.4645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9784 -8.9646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6744 -8.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1857 -8.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8786 -7.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3359 -7.4702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8647 -9.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6817 -9.8451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0564 -9.8187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6079 -8.7130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3146 -9.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6100 -7.8958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0762 -10.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8932 -10.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6536 -11.2603 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 18 1 0
5 20 1 0
22 16 1 0
21 23 1 0
17 2 1 6
2 8 1 0
13 25 1 0
21 1 2 0
9 10 1 1
27 24 2 0
23 15 1 0
17 26 1 0
26 3 2 0
23 7 1 0
27 5 1 0
7 9 1 0
24 21 1 0
22 4 1 6
14 10 1 0
11 27 1 0
16 14 1 0
16 18 1 0
7 13 1 0
7 19 1 1
9 1 1 0
12 11 2 0
22 17 1 0
25 17 1 0
1 12 1 0
9 22 1 0
25 6 1 1
13 28 1 6
28 29 1 0
13 30 1 0
6 31 1 0
31 32 1 0
31 33 2 0
29 34 1 0
34 35 1 0
34 36 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.58Molecular Weight (Monoisotopic): 469.2577AlogP: 1.60#Rotatable Bonds: 5Polar Surface Area: 91.34Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.81CX Basic pKa: 8.88CX LogP: 0.98CX LogD: -0.52Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: 1.68
References 1. Xiao C, Tian Y, Lei M, Chen F, Gan X, Yao X, Shen X, Chen J, Hu L.. (2017) Synthesis and glucose-stimulate insulin secretion (GSIS) evaluation of vindoline derivatives., 27 (5): [PMID:28162858 ] [10.1016/j.bmcl.2016.09.064 ]