N'-(4-methoxybenzylidene)-2-(1,2-dihydro-2-(4-methoxyphenyl)-4-oxoquinazolin-3(4H)-yl)acetohydrazide

ID: ALA4097926

PubChem CID: 137660868

Max Phase: Preclinical

Molecular Formula: C25H24N4O4

Molecular Weight: 444.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(/C=N/NC(=O)CN2C(=O)c3ccccc3NC2c2ccc(OC)cc2)cc1

Standard InChI:  InChI=1S/C25H24N4O4/c1-32-19-11-7-17(8-12-19)15-26-28-23(30)16-29-24(18-9-13-20(33-2)14-10-18)27-22-6-4-3-5-21(22)25(29)31/h3-15,24,27H,16H2,1-2H3,(H,28,30)/b26-15+

Standard InChI Key:  WWUDUOSUPMOYBI-CVKSISIWSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    8.2572   -3.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2560   -4.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9641   -4.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9623   -2.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6709   -3.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6697   -4.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3759   -4.6310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0878   -4.2240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0890   -3.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3783   -2.9897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3737   -5.4482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7977   -2.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7944   -4.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7921   -5.4517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4987   -5.8623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0833   -5.8583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4964   -6.6795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2029   -7.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2007   -7.9072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5028   -3.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2110   -3.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2135   -2.1871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5018   -1.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7965   -2.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4918   -8.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4891   -9.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1962   -9.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9074   -9.1255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9066   -8.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9216   -1.7793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1950  -10.3537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4867  -10.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9225   -0.9621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  7 11  2  0
  9 12  1  0
  8 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 12 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 12  1  0
 19 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 19  1  0
 22 30  1  0
 27 31  1  0
 31 32  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4097926

    ---

Associated Targets(non-human)

Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 444.49Molecular Weight (Monoisotopic): 444.1798AlogP: 3.42#Rotatable Bonds: 7
Polar Surface Area: 92.26Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.62CX Basic pKa: 1.73CX LogP: 3.77CX LogD: 3.77
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: -1.16

References

1. Khattab SN, Haiba NS, Asal AM, Bekhit AA, Guemei AA, Amer A, El-Faham A..  (2017)  Study of antileishmanial activity of 2-aminobenzoyl amino acid hydrazides and their quinazoline derivatives.,  27  (4): [PMID:28087274] [10.1016/j.bmcl.2017.01.003]

Source