N2-(2-Dimethylaminoethyl)-N4-decyl-6-methylpyrimidine-2,4-diamine

ID: ALA4098509

PubChem CID: 137659724

Max Phase: Preclinical

Molecular Formula: C19H37N5

Molecular Weight: 335.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCNc1cc(C)nc(NCCN(C)C)n1

Standard InChI:  InChI=1S/C19H37N5/c1-5-6-7-8-9-10-11-12-13-20-18-16-17(2)22-19(23-18)21-14-15-24(3)4/h16H,5-15H2,1-4H3,(H2,20,21,22,23)

Standard InChI Key:  YTWXKAWNLYIAPW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 24  0  0  0  0  0  0  0  0999 V2000
    8.5119   -6.9017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2243   -6.4949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2270   -5.6777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5214   -5.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8130   -5.6700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8062   -6.4872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5092   -7.7189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9354   -5.2750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1073   -5.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2148   -8.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2080   -8.9464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9137   -9.3609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9110  -10.1781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6262   -8.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6359   -5.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3458   -5.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0474   -5.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7573   -5.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4589   -5.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1688   -5.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8723   -5.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5841   -5.3260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2877   -5.7418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9995   -5.3404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  2  0
  1  7  1  0
  3  8  1  0
  5  9  1  0
 10 11  1  0
 12 13  1  0
 12 14  1  0
 11 12  1  0
  7 10  1  0
  8 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4098509

    ---

Associated Targets(Human)

DNM2 Tchem Dynamin-2 (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 335.54Molecular Weight (Monoisotopic): 335.3049AlogP: 4.31#Rotatable Bonds: 14
Polar Surface Area: 53.08Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.68CX LogP: 4.41CX LogD: 3.01
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.50Np Likeness Score: -1.15

References

1. Odell LR, Abdel-Hamid MK, Hill TA, Chau N, Young KA, Deane FM, Sakoff JA, Andersson S, Daniel JA, Robinson PJ, McCluskey A..  (2017)  Pyrimidine-Based Inhibitors of Dynamin I GTPase Activity: Competitive Inhibition at the Pleckstrin Homology Domain.,  60  (1): [PMID:27997171] [10.1021/acs.jmedchem.6b01422]

Source