The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(5-(tert-butyl)isoxazol-3-yl)-3-(3-methyl-4-((6-(piperidin-1-yl)pyrimidin-4-yl)oxy)phenyl)urea ID: ALA4098693
PubChem CID: 137659983
Max Phase: Preclinical
Molecular Formula: C24H30N6O3
Molecular Weight: 450.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(NC(=O)Nc2cc(C(C)(C)C)on2)ccc1Oc1cc(N2CCCCC2)ncn1
Standard InChI: InChI=1S/C24H30N6O3/c1-16-12-17(27-23(31)28-20-13-19(33-29-20)24(2,3)4)8-9-18(16)32-22-14-21(25-15-26-22)30-10-6-5-7-11-30/h8-9,12-15H,5-7,10-11H2,1-4H3,(H2,27,28,29,31)
Standard InChI Key: CZHIKAJESJNHTF-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
21.7738 -8.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7727 -8.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4807 -9.3220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1904 -8.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1876 -8.0899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4790 -7.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0647 -9.3210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3573 -8.9119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6492 -9.3199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3579 -8.0947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8937 -7.6786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6030 -8.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6027 -8.8994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3111 -9.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0183 -8.8939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0126 -8.0725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3036 -7.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9419 -8.9108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8618 -8.0998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0626 -7.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6534 -8.6367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1998 -9.2443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4765 -6.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7137 -7.6589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4242 -8.0645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1269 -7.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1251 -6.8367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4146 -6.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7058 -6.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8406 -8.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3607 -8.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5077 -9.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0219 -8.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
5 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
9 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 18 1 0
6 23 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
16 24 1 0
21 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.54Molecular Weight (Monoisotopic): 450.2379AlogP: 5.50#Rotatable Bonds: 5Polar Surface Area: 105.41Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.27CX Basic pKa: 4.63CX LogP: 5.78CX LogD: 5.73Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.53Np Likeness Score: -1.96
References 1. Chen Y, Zheng Y, Jiang Q, Qin F, Zhang Y, Fu L, He G.. (2017) Integrated bioinformatics, computational and experimental methods to discover novel Raf/extracellular-signal regulated kinase (ERK) dual inhibitors against breast cancer cells., 127 [PMID:27839788 ] [10.1016/j.ejmech.2016.11.009 ]