The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl trans-{5-[(3-benzyl-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl)methyl]-2-methylisoxazolidin-3-yl}phosphonate ID: ALA4098818
PubChem CID: 137662067
Max Phase: Preclinical
Molecular Formula: C24H30N3O6P
Molecular Weight: 487.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)[C@@H]1C[C@@H](Cn2c(=O)n(Cc3ccccc3)c(=O)c3ccccc32)ON1C
Standard InChI: InChI=1S/C24H30N3O6P/c1-4-31-34(30,32-5-2)22-15-19(33-25(22)3)17-26-21-14-10-9-13-20(21)23(28)27(24(26)29)16-18-11-7-6-8-12-18/h6-14,19,22H,4-5,15-17H2,1-3H3/t19-,22+/m0/s1
Standard InChI Key: DZXWVEFEOJISCG-SIKLNZKXSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
4.7912 -4.1974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4965 -3.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4965 -2.9757 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7912 -2.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0860 -3.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0885 -2.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3848 -2.5694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6780 -2.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6794 -3.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3837 -4.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7898 -1.7458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2036 -4.2025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7912 -5.0146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0835 -5.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3346 -5.0897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7878 -5.6970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1964 -6.4048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9957 -6.2348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2054 -2.5692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9119 -2.9799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9080 -3.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6136 -4.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3235 -3.8021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3233 -2.9807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6170 -2.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9751 -5.6116 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
1.6427 -4.8651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4947 -6.2727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3773 -6.3147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9659 -7.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3717 -7.7301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6820 -6.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2017 -6.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8641 -7.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 1 0
2 3 1 0
3 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
4 11 2 0
2 12 2 0
1 13 1 0
14 13 1 1
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
3 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
16 26 1 6
26 27 2 0
26 28 1 0
26 29 1 0
29 30 1 0
30 31 1 0
28 32 1 0
32 33 1 0
17 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.49Molecular Weight (Monoisotopic): 487.1872AlogP: 3.44#Rotatable Bonds: 9Polar Surface Area: 92.00Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.12CX LogD: 3.12Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -0.58
References 1. Piotrowska DG, Andrei G, Schols D, Snoeck R, Łysakowska M.. (2017) Synthesis, anti-varicella-zoster virus and anti-cytomegalovirus activity of quinazoline-2,4-diones containing isoxazolidine and phosphonate substructures., 126 [PMID:27750154 ] [10.1016/j.ejmech.2016.10.002 ]