Diethyl trans-{5-[(3-benzyl-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl)methyl]-2-methylisoxazolidin-3-yl}phosphonate

ID: ALA4098818

PubChem CID: 137662067

Max Phase: Preclinical

Molecular Formula: C24H30N3O6P

Molecular Weight: 487.49

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOP(=O)(OCC)[C@@H]1C[C@@H](Cn2c(=O)n(Cc3ccccc3)c(=O)c3ccccc32)ON1C

Standard InChI:  InChI=1S/C24H30N3O6P/c1-4-31-34(30,32-5-2)22-15-19(33-25(22)3)17-26-21-14-10-9-13-20(21)23(28)27(24(26)29)16-18-11-7-6-8-12-18/h6-14,19,22H,4-5,15-17H2,1-3H3/t19-,22+/m0/s1

Standard InChI Key:  DZXWVEFEOJISCG-SIKLNZKXSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    4.7912   -4.1974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4965   -3.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4965   -2.9757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7912   -2.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0860   -3.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0885   -2.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3848   -2.5694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6780   -2.9756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6794   -3.7941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3837   -4.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7898   -1.7458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2036   -4.2025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7912   -5.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0835   -5.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3346   -5.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7878   -5.6970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1964   -6.4048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9957   -6.2348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2054   -2.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9119   -2.9799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9080   -3.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6136   -4.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3235   -3.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3233   -2.9807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6170   -2.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9751   -5.6116    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.6427   -4.8651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4947   -6.2727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3773   -6.3147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9659   -7.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3717   -7.7301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6820   -6.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2017   -6.8484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8641   -7.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  4 11  2  0
  2 12  2  0
  1 13  1  0
 14 13  1  1
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 14  1  0
  3 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 16 26  1  6
 26 27  2  0
 26 28  1  0
 26 29  1  0
 29 30  1  0
 30 31  1  0
 28 32  1  0
 32 33  1  0
 17 34  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4098818

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 487.49

Molecular Weight (Monoisotopic): 487.1872

AlogP: 3.44

#Rotatable Bonds: 9

Polar Surface Area: 92.00

Molecular Species: NEUTRAL

HBA: 9

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): 9

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 3.12

CX LogD: 3.12

Aromatic Rings: 3

Heavy Atoms: 34

QED Weighted: 0.43

Np Likeness Score: -0.58

References

1. Piotrowska DG, Andrei G, Schols D, Snoeck R, Łysakowska M..  (2017)  Synthesis, anti-varicella-zoster virus and anti-cytomegalovirus activity of quinazoline-2,4-diones containing isoxazolidine and phosphonate substructures.,  126  [PMID:27750154] [10.1016/j.ejmech.2016.10.002]

Source

Source(1):

• Scientific Literature