The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(4-Ethylphenylamino)benzo[d]oxazol-5-yl)-2-phenylacetamide ID: ALA4098865
PubChem CID: 54768029
Max Phase: Preclinical
Molecular Formula: C23H21N3O2
Molecular Weight: 371.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(Nc2nc3cc(NC(=O)Cc4ccccc4)ccc3o2)cc1
Standard InChI: InChI=1S/C23H21N3O2/c1-2-16-8-10-18(11-9-16)25-23-26-20-15-19(12-13-21(20)28-23)24-22(27)14-17-6-4-3-5-7-17/h3-13,15H,2,14H2,1H3,(H,24,27)(H,25,26)
Standard InChI Key: JMBSMNAJQSCROM-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
12.7146 -4.7380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7134 -5.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4215 -5.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4197 -4.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1283 -4.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1331 -5.5530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9131 -5.8015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3905 -5.1364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9054 -4.4770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2077 -5.1315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6121 -4.4214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4292 -4.4194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8335 -3.7101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4207 -3.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5993 -3.0113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1987 -3.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8242 -2.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4105 -1.5884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0068 -4.3296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2992 -4.7384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5914 -4.3299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2994 -5.5556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8837 -4.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1765 -4.3285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4693 -4.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4691 -5.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1819 -5.9629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8861 -5.5525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
17 18 1 0
1 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 371.44Molecular Weight (Monoisotopic): 371.1634AlogP: 5.32#Rotatable Bonds: 6Polar Surface Area: 67.16Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.30CX Basic pKa: ┄CX LogP: 5.47CX LogD: 5.47Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.48Np Likeness Score: -1.52
References 1. Kim D, Won HY, Hwang ES, Kim YK, Choo HP.. (2017) Synthesis of benzoxazole derivatives as interleukin-6 antagonists., 25 (12): [PMID:28442260 ] [10.1016/j.bmc.2017.03.072 ]