The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5-Chloro-2-(2-((methyl-d3)amino)thiazol-4-yl)-pyridin-4-yl)(4-(4-chlorobenzyl)piperazin-1-yl)methanone ID: ALA4098876
PubChem CID: 137660903
Max Phase: Preclinical
Molecular Formula: C21H21Cl2N5OS
Molecular Weight: 462.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: [2H]C([2H])([2H])Nc1nc(-c2cc(C(=O)N3CCN(Cc4ccc(Cl)cc4)CC3)c(Cl)cn2)cs1
Standard InChI: InChI=1S/C21H21Cl2N5OS/c1-24-21-26-19(13-30-21)18-10-16(17(23)11-25-18)20(29)28-8-6-27(7-9-28)12-14-2-4-15(22)5-3-14/h2-5,10-11,13H,6-9,12H2,1H3,(H,24,26)/i1D3
Standard InChI Key: MVXAYIXYYOVALX-FIBGUPNXSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
34.7705 -23.2734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7693 -24.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4815 -24.5060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4797 -22.8604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1925 -23.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1932 -24.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0606 -22.8610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4834 -25.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7725 -25.7417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1962 -25.7384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0604 -25.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3516 -25.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3493 -26.5605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0619 -26.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7769 -26.5612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6369 -26.9722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9256 -26.5584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9311 -25.7399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2207 -25.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5114 -25.7380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5128 -26.5635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2197 -26.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7996 -25.3293 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.9761 -22.0490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1746 -21.8788 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.7622 -22.5888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3114 -23.1991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.9453 -22.6736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4655 -22.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9021 -24.4995 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
31.7984 -21.2616 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
30.6485 -22.0969 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.0450 -21.2965 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
1 7 1 0
3 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
9 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
7 24 2 0
24 25 1 0
25 26 1 0
26 27 2 0
27 7 1 0
26 28 1 0
28 29 1 0
6 30 1 0
29 31 1 0
29 32 1 0
29 33 1 0
M ISO 3 31 2 32 2 33 2
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.41Molecular Weight (Monoisotopic): 461.0844AlogP: 4.51#Rotatable Bonds: 5Polar Surface Area: 61.36Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.74CX LogP: 4.07CX LogD: 4.06Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.60Np Likeness Score: -2.05
References 1. Yamada K, Levell J, Yoon T, Kohls D, Yowe D, Rigel DF, Imase H, Yuan J, Yasoshima K, DiPetrillo K, Monovich L, Xu L, Zhu M, Kato M, Jain M, Idamakanti N, Taslimi P, Kawanami T, Argikar UA, Kunjathoor V, Xie X, Yagi YI, Iwaki Y, Robinson Z, Park HM.. (2017) Optimization of Allosteric With-No-Lysine (WNK) Kinase Inhibitors and Efficacy in Rodent Hypertension Models., 60 (16): [PMID:28771350 ] [10.1021/acs.jmedchem.7b00708 ]