The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-((S)-2-((S)-1-(benzyloxycarbonyl)pyrrolidine-2-carboxamido)-5-guanidinopentanamido)benzyloxy)carbonylamino)-1-hydroxybutane-1,1-diyldiphosphonic acid ID: ALA4098966
PubChem CID: 129110487
Max Phase: Preclinical
Molecular Formula: C31H45N7O13P2
Molecular Weight: 785.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)OCc1ccccc1)C(=O)Nc1ccc(COC(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O)cc1
Standard InChI: InChI=1S/C31H45N7O13P2/c32-28(33)34-16-4-9-24(37-27(40)25-10-5-18-38(25)30(42)51-20-21-7-2-1-3-8-21)26(39)36-23-13-11-22(12-14-23)19-50-29(41)35-17-6-15-31(43,52(44,45)46)53(47,48)49/h1-3,7-8,11-14,24-25,43H,4-6,9-10,15-20H2,(H,35,41)(H,36,39)(H,37,40)(H4,32,33,34)(H2,44,45,46)(H2,47,48,49)/t24-,25-/m0/s1
Standard InChI Key: FDQCAKSAVGZLLI-DQEYMECFSA-N
Molfile:
RDKit 2D
53 55 0 0 0 0 0 0 0 0999 V2000
15.6051 -3.3018 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
16.7235 -1.5353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0178 -1.9481 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
16.7281 -2.3529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9044 -6.3188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5673 -5.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3047 -5.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4999 -5.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2455 -5.8367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3565 -6.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5376 -6.8859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9564 -5.5280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7376 -5.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3358 -5.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9207 -6.5641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1171 -5.4506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1528 -4.4145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7153 -4.8939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4930 -5.1381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0909 -4.5822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9080 -3.7848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1220 -3.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5275 -4.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5055 -3.2272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2871 -3.4659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8845 -2.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6661 -3.1470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7004 -2.1122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2635 -2.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0451 -2.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6426 -2.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4241 -2.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2118 -2.7157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0108 -3.8629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8375 -1.1555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4222 -3.3018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0136 -4.0095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7019 -6.8038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8850 -7.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6663 -7.8399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8493 -8.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6306 -8.8760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2511 -9.1930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9048 -7.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1973 -7.5449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6127 -7.5442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1978 -8.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4903 -8.7711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7842 -8.3590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0772 -8.7673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0772 -9.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7901 -9.9934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4942 -9.5828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 36 1 0
37 1 2 0
3 2 1 0
4 3 2 0
8 9 1 0
6 7 1 0
5 6 1 0
7 8 1 0
9 5 1 0
6 10 1 1
10 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
13 15 1 6
14 16 1 0
14 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 3 1 0
32 1 1 0
32 33 1 0
1 34 1 0
3 35 1 0
15 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 2 0
41 43 1 0
5 44 1 0
44 45 1 0
44 46 2 0
45 47 1 0
47 48 1 0
48 49 2 0
49 50 1 0
50 51 2 0
51 52 1 0
52 53 2 0
53 48 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 785.69Molecular Weight (Monoisotopic): 785.2551AlogP: 1.18#Rotatable Bonds: 18Polar Surface Area: 323.26Molecular Species: ZWITTERIONHBA: 10HBD: 11#RO5 Violations: 2HBA (Lipinski): 20HBD (Lipinski): 12#RO5 Violations (Lipinski): 3CX Acidic pKa: 0.69CX Basic pKa: 11.76CX LogP: -0.89CX LogD: -3.25Aromatic Rings: 2Heavy Atoms: 53QED Weighted: 0.04Np Likeness Score: -0.40
References 1. Xie H, Chen G, Young RN.. (2017) Design, Synthesis, and Pharmacokinetics of a Bone-Targeting Dual-Action Prodrug for the Treatment of Osteoporosis., 60 (16): [PMID:28699744 ] [10.1021/acs.jmedchem.6b00951 ]