The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,4R)-4-(4-((E)-3-(2-aminophenylamino)-3-oxoprop-1-enyl)-1H-1,2,3-triazol-1-yl)-1-(3-phenylpropyl)pyrrolidine-2-carboxylic acid ID: ALA4098970
PubChem CID: 137661389
Max Phase: Preclinical
Molecular Formula: C25H28N6O3
Molecular Weight: 460.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccccc1NC(=O)/C=C/c1cn([C@@H]2C[C@H](C(=O)O)N(CCCc3ccccc3)C2)nn1
Standard InChI: InChI=1S/C25H28N6O3/c26-21-10-4-5-11-22(21)27-24(32)13-12-19-16-31(29-28-19)20-15-23(25(33)34)30(17-20)14-6-9-18-7-2-1-3-8-18/h1-5,7-8,10-13,16,20,23H,6,9,14-15,17,26H2,(H,27,32)(H,33,34)/b13-12+/t20-,23-/m1/s1
Standard InChI Key: PPETWBUGLLZQBC-FJYVLNHRSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
2.7719 -18.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7702 -19.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4797 -19.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1959 -19.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1916 -18.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4812 -18.0370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4794 -20.4972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9060 -19.6770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6141 -19.2668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3242 -19.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6122 -18.4454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0364 -19.2634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7465 -19.6744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8260 -20.4866 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6289 -20.6555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0400 -19.9453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4906 -19.3362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8500 -19.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4035 -20.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1500 -20.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0639 -19.3148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2610 -19.1463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6690 -18.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4510 -19.0180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0601 -18.4686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8422 -18.7171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0092 -19.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7859 -19.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3965 -19.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2225 -18.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4421 -18.1695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8601 -20.5402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8622 -21.3574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5682 -20.1257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 13 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
18 16 1 1
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
20 32 1 1
32 33 1 0
32 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.54Molecular Weight (Monoisotopic): 460.2223AlogP: 2.85#Rotatable Bonds: 9Polar Surface Area: 126.37Molecular Species: ZWITTERIONHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.43CX Basic pKa: 9.86CX LogP: 0.41CX LogD: 0.40Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: -0.96
References 1. Tian Y, Lv W, Li X, Wang C, Wang D, Wang PG, Jin J, Shen J.. (2017) Stabilizing HDAC11 with SAHA to assay slow-binding benzamide inhibitors., 27 (13): [PMID:28501514 ] [10.1016/j.bmcl.2017.05.004 ]