The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[2-(2-Fluorophenyl)-4-(4-methoxybenzyl)-4H-thieno[3,2-b]-pyrrole-5-carbonyl]-N-propylpiperidine-4-carboxamide ID: ALA4099115
PubChem CID: 137660225
Max Phase: Preclinical
Molecular Formula: C30H32FN3O3S
Molecular Weight: 533.67
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCNC(=O)C1CCN(C(=O)c2cc3sc(-c4ccccc4F)cc3n2Cc2ccc(OC)cc2)CC1
Standard InChI: InChI=1S/C30H32FN3O3S/c1-3-14-32-29(35)21-12-15-33(16-13-21)30(36)26-18-28-25(17-27(38-28)23-6-4-5-7-24(23)31)34(26)19-20-8-10-22(37-2)11-9-20/h4-11,17-18,21H,3,12-16,19H2,1-2H3,(H,32,35)
Standard InChI Key: BGSDPTPWWIRWHY-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
42.9490 -23.9411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4263 -25.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4450 -26.7865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.9178 -26.1115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6546 -26.5412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6452 -25.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8577 -25.4700 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.3803 -26.1430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8728 -26.8049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7118 -27.5671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1691 -28.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3606 -28.0274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8182 -28.6480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0848 -29.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8990 -29.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4379 -28.9652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7427 -26.0999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1653 -26.8085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.1451 -25.3797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.9697 -25.3704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3721 -24.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1271 -23.9530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7203 -24.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3520 -23.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1770 -23.2104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.9302 -22.5124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.5988 -23.9194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4237 -23.9086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8456 -24.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5553 -26.1524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5430 -30.0516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7334 -29.8935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1399 -25.4418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3157 -25.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9106 -26.1705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3356 -26.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1583 -26.8700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5827 -27.5775 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
5 3 1 0
3 4 1 0
4 2 2 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
3 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
4 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
19 23 1 0
20 21 1 0
21 1 1 0
1 22 1 0
22 23 1 0
1 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
8 30 1 0
14 31 1 0
31 32 1 0
30 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 30 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.67Molecular Weight (Monoisotopic): 533.2148AlogP: 5.94#Rotatable Bonds: 8Polar Surface Area: 63.57Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.12CX LogD: 5.12Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: -1.77
References 1. Ching KC, Tran TN, Amrun SN, Kam YW, Ng LF, Chai CL.. (2017) Structural Optimizations of Thieno[3,2-b]pyrrole Derivatives for the Development of Metabolically Stable Inhibitors of Chikungunya Virus., 60 (7): [PMID:28350454 ] [10.1021/acs.jmedchem.7b00180 ]