1-[2-(2-Fluorophenyl)-4-(4-methoxybenzyl)-4H-thieno[3,2-b]-pyrrole-5-carbonyl]-N-propylpiperidine-4-carboxamide

ID: ALA4099115

PubChem CID: 137660225

Max Phase: Preclinical

Molecular Formula: C30H32FN3O3S

Molecular Weight: 533.67

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCNC(=O)C1CCN(C(=O)c2cc3sc(-c4ccccc4F)cc3n2Cc2ccc(OC)cc2)CC1

Standard InChI:  InChI=1S/C30H32FN3O3S/c1-3-14-32-29(35)21-12-15-33(16-13-21)30(36)26-18-28-25(17-27(38-28)23-6-4-5-7-24(23)31)34(26)19-20-8-10-22(37-2)11-9-20/h4-11,17-18,21H,3,12-16,19H2,1-2H3,(H,32,35)

Standard InChI Key:  BGSDPTPWWIRWHY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   42.9490  -23.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4263  -25.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4450  -26.7865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.9178  -26.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6546  -26.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6452  -25.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8577  -25.4700    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   38.3803  -26.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8728  -26.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7118  -27.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1691  -28.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3606  -28.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8182  -28.6480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0848  -29.4296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8990  -29.5870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4379  -28.9652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7427  -26.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1653  -26.8085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.1451  -25.3797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.9697  -25.3704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3721  -24.6543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1271  -23.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7203  -24.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3520  -23.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1770  -23.2104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.9302  -22.5124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.5988  -23.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4237  -23.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8456  -24.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5553  -26.1524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5430  -30.0516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7334  -29.8935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1399  -25.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3157  -25.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9106  -26.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3356  -26.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1583  -26.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5827  -27.5775    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  6  1  0
  5  3  1  0
  3  4  1  0
  4  2  2  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  3 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  4 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 19 23  1  0
 20 21  1  0
 21  1  1  0
  1 22  1  0
 22 23  1  0
  1 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
  8 30  1  0
 14 31  1  0
 31 32  1  0
 30 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 30  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4099115

    ---

Associated Targets(Human)

Liver (3974 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 533.67Molecular Weight (Monoisotopic): 533.2148AlogP: 5.94#Rotatable Bonds: 8
Polar Surface Area: 63.57Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.12CX LogD: 5.12
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: -1.77

References

1. Ching KC, Tran TN, Amrun SN, Kam YW, Ng LF, Chai CL..  (2017)  Structural Optimizations of Thieno[3,2-b]pyrrole Derivatives for the Development of Metabolically Stable Inhibitors of Chikungunya Virus.,  60  (7): [PMID:28350454] [10.1021/acs.jmedchem.7b00180]

Source