The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Chloro-9-methoxy-6-(3-morpholinopropyl)-5H-pyrido-[3',2':4,5]cyclopenta[1,2-c]isoquinoline-5,11(6H)-dione ID: ALA4099136
PubChem CID: 137661166
Max Phase: Preclinical
Molecular Formula: C23H22ClN3O4
Molecular Weight: 439.90
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cnc2c(c1)C(=O)c1c-2n(CCCN2CCOCC2)c(=O)c2cc(Cl)ccc12
Standard InChI: InChI=1S/C23H22ClN3O4/c1-30-15-12-18-20(25-13-15)21-19(22(18)28)16-4-3-14(24)11-17(16)23(29)27(21)6-2-5-26-7-9-31-10-8-26/h3-4,11-13H,2,5-10H2,1H3
Standard InChI Key: LEUOQDXUTZNMKV-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
5.7478 -6.1867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7467 -7.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4547 -7.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4529 -5.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1615 -6.1831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1604 -7.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8666 -7.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5785 -7.0057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8689 -5.7715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5779 -6.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0393 -4.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4926 -4.3634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8535 -4.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1842 -5.6327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9952 -5.7188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4763 -5.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1407 -4.3095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3307 -4.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8643 -8.2300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2855 -7.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2841 -8.2327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9911 -8.6425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9897 -9.4597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6191 -3.6470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4321 -3.7301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2786 -9.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2752 -10.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9804 -11.0914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6906 -10.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6957 -9.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0386 -7.4142 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 2 0
10 14 1 0
13 11 1 0
11 9 1 0
11 12 2 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
7 19 2 0
8 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
17 24 1 0
24 25 1 0
23 26 1 0
23 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
2 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.90Molecular Weight (Monoisotopic): 439.1299AlogP: 2.99#Rotatable Bonds: 5Polar Surface Area: 73.66Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.05CX LogP: 1.59CX LogD: 1.57Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: -0.69
References 1. Elsayed MSA, Su Y, Wang P, Sethi T, Agama K, Ravji A, Redon CE, Kiselev E, Horzmann KA, Freeman JL, Pommier Y, Cushman M.. (2017) Design and Synthesis of Chlorinated and Fluorinated 7-Azaindenoisoquinolines as Potent Cytotoxic Anticancer Agents That Inhibit Topoisomerase I., 60 (13): [PMID:28657311 ] [10.1021/acs.jmedchem.6b01870 ]