3(R)-[N-(3alpha-Hydroxy-5beta-cholan-24-oyl)amino]-3-phenylpropionic acid

ID: ALA4099159

PubChem CID: 137661854

Max Phase: Preclinical

Molecular Formula: C33H49NO4

Molecular Weight: 523.76

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](CCC(=O)N[C@H](CC(=O)O)c1ccccc1)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C33H49NO4/c1-21(9-14-30(36)34-29(20-31(37)38)22-7-5-4-6-8-22)26-12-13-27-25-11-10-23-19-24(35)15-17-32(23,2)28(25)16-18-33(26,27)3/h4-8,21,23-29,35H,9-20H2,1-3H3,(H,34,36)(H,37,38)/t21-,23-,24-,25+,26-,27+,28+,29-,32+,33-/m1/s1

Standard InChI Key:  MMXSBHIHNUQNHB-MBSFSUHJSA-N

Molfile:  

     RDKit          2D

 43 47  0  0  0  0  0  0  0  0999 V2000
   30.2526  -15.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2526  -16.3521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9579  -16.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9579  -15.1222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6631  -15.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6642  -16.3521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3685  -16.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0763  -16.3503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3664  -15.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0772  -15.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0759  -13.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3627  -14.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7867  -14.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7836  -15.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5640  -15.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0495  -14.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5690  -14.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5455  -16.7617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6558  -14.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6600  -17.1651    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   32.3616  -15.9394    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.0715  -14.7136    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.7772  -15.9435    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.7814  -13.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8245  -13.2784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6244  -13.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2800  -12.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1690  -13.7209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9689  -13.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2244  -12.7777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3538  -13.8386    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.5135  -14.1633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.3134  -13.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5689  -13.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3688  -13.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6243  -12.2770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.9134  -13.6626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.8577  -14.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6006  -15.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1444  -15.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9453  -15.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1995  -15.0400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6541  -14.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
  2 18  1  6
  5 19  1  1
  6 20  1  1
  9 21  1  6
 10 22  1  1
 14 23  1  6
 13 24  1  1
 17 25  1  0
 25 26  1  0
 25 27  1  6
 26 28  1  0
 28 29  1  0
 29 30  2  0
 17 31  1  6
 29 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  2  0
 35 37  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 42  1  0
 42 43  2  0
 43 38  1  0
 33 38  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4099159

    ---

Associated Targets(non-human)

Epha2 Ephrin type-A receptor 2 (49 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.76Molecular Weight (Monoisotopic): 523.3662AlogP: 6.75#Rotatable Bonds: 8
Polar Surface Area: 86.63Molecular Species: ACIDHBA: 3HBD: 3
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.43CX Basic pKa: CX LogP: 5.94CX LogD: 3.08
Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.35Np Likeness Score: 1.38

References

1. Incerti M, Russo S, Callegari D, Pala D, Giorgio C, Zanotti I, Barocelli E, Vicini P, Vacondio F, Rivara S, Castelli R, Tognolini M, Lodola A..  (2017)  Metadynamics for Perspective Drug Design: Computationally Driven Synthesis of New Protein-Protein Interaction Inhibitors Targeting the EphA2 Receptor.,  60  (2): [PMID:28005388] [10.1021/acs.jmedchem.6b01642]

Source