The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((1-((R)-1-(difluoromethoxy)propan-2-yl)-7-(3,5-dimethylisoxazol-4-yl)-8-methoxy-1H-imidazo[4,5-c]quinolin-2-yl)methyl)morpholine ID: ALA4099187
PubChem CID: 122470439
Max Phase: Preclinical
Molecular Formula: C25H29F2N5O4
Molecular Weight: 501.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1-c1c(C)noc1C)ncc1nc(CN3CCOCC3)n([C@H](C)COC(F)F)c12
Standard InChI: InChI=1S/C25H29F2N5O4/c1-14(13-35-25(26)27)32-22(12-31-5-7-34-8-6-31)29-20-11-28-19-9-18(23-15(2)30-36-16(23)3)21(33-4)10-17(19)24(20)32/h9-11,14,25H,5-8,12-13H2,1-4H3/t14-/m1/s1
Standard InChI Key: QZHDKVJVAHXYTH-CQSZACIVSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
23.7947 -21.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7935 -22.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5084 -22.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5065 -21.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2219 -21.6508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2227 -22.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9380 -22.8885 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6531 -22.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9324 -21.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6472 -21.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2527 -21.0859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9119 -20.3386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0960 -20.4318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5386 -19.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7866 -19.0368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7332 -20.0024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1757 -19.3942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0808 -21.2418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0814 -22.8970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3280 -22.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7755 -23.1735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1875 -23.8884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9945 -23.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1571 -21.7538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6072 -24.2699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3141 -19.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1401 -19.6164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5524 -20.3285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3747 -20.3252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7869 -19.6090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3705 -18.8946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5419 -18.8964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3892 -18.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8059 -18.0139 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.1861 -18.3838 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.0812 -20.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 10 1 0
9 5 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 1 0
13 14 1 0
14 15 1 1
14 16 1 0
16 17 1 0
1 18 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 19 2 0
2 19 1 0
20 24 1 0
23 25 1 0
26 27 1 0
12 26 1 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
17 33 1 0
33 34 1 0
33 35 1 0
18 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.53Molecular Weight (Monoisotopic): 501.2188AlogP: 4.50#Rotatable Bonds: 8Polar Surface Area: 87.67Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.14CX LogP: 2.92CX LogD: 2.92Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -1.42
References 1. Liu Z, Wang P, Chen H, Wold EA, Tian B, Brasier AR, Zhou J.. (2017) Drug Discovery Targeting Bromodomain-Containing Protein 4., 60 (11): [PMID:28195723 ] [10.1021/acs.jmedchem.6b01761 ]