N-(2-(4-Ethylphenylamino)benzo[d]oxazol-5-yl)-3,4-dimethoxybenzamide

ID: ALA4099527

PubChem CID: 54765794

Max Phase: Preclinical

Molecular Formula: C24H23N3O4

Molecular Weight: 417.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1ccc(Nc2nc3cc(NC(=O)c4ccc(OC)c(OC)c4)ccc3o2)cc1

Standard InChI:  InChI=1S/C24H23N3O4/c1-4-15-5-8-17(9-6-15)26-24-27-19-14-18(10-12-20(19)31-24)25-23(28)16-7-11-21(29-2)22(13-16)30-3/h5-14H,4H2,1-3H3,(H,25,28)(H,26,27)

Standard InChI Key:  VOOLDZMGPNPSMY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   36.9125  -20.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9114  -20.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6194  -21.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6176  -19.7196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3262  -20.1249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3310  -20.9435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1111  -21.1919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5884  -20.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1033  -19.8674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4056  -20.5220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.8100  -19.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6271  -19.8098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0315  -19.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6186  -18.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7973  -18.4017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3966  -19.1116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0221  -17.6836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6084  -16.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2047  -19.7200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.2045  -18.9028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4967  -18.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9121  -18.4941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.5018  -17.6765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7948  -17.2681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0862  -17.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0891  -18.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7966  -18.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3779  -17.2694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3829  -18.9096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3766  -16.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6737  -18.5037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 17 18  1  0
  1 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 21  1  0
 25 28  1  0
 26 29  1  0
 28 30  1  0
 29 31  1  0
M  END

Associated Targets(Human)

IL6 Tclin Interleukin-6 (43 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 417.47Molecular Weight (Monoisotopic): 417.1689AlogP: 5.40#Rotatable Bonds: 7
Polar Surface Area: 85.62Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.30CX Basic pKa: CX LogP: 5.18CX LogD: 5.18
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -1.29

References

1. Kim D, Won HY, Hwang ES, Kim YK, Choo HP..  (2017)  Synthesis of benzoxazole derivatives as interleukin-6 antagonists.,  25  (12): [PMID:28442260] [10.1016/j.bmc.2017.03.072]

Source