2-(Benzo[d]isoxazol-3-yl)-N-(4-chloro-3-(trifluoromethyl)phenyl)-2-oxoacetohydrazonoyl cyanide

ID: ALA4099528

PubChem CID: 137662326

Max Phase: Preclinical

Molecular Formula: C17H8ClF3N4O2

Molecular Weight: 392.72

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#C/C(=N\Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)c1noc2ccccc12

Standard InChI:  InChI=1S/C17H8ClF3N4O2/c18-12-6-5-9(7-11(12)17(19,20)21)23-24-13(8-22)16(26)15-10-3-1-2-4-14(10)27-25-15/h1-7,23H/b24-13+

Standard InChI Key:  LVQHZXLSPXWLOW-ZMOGYAJESA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    2.3263   -5.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3252   -6.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0374   -6.4618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7512   -6.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7483   -5.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0356   -4.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0331   -3.9949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7438   -3.5842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7413   -2.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4519   -2.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4495   -1.5267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1650   -2.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4603   -3.0279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9075   -2.4223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0251   -2.3553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3120   -1.9488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0538   -3.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2515   -3.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7031   -4.1810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9560   -4.9608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7622   -5.1274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3070   -4.5163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4636   -6.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4649   -7.2812    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.1748   -6.0501    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.1714   -6.8718    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.0372   -7.2790    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 18  1  0
 17 13  1  0
 13 14  1  0
 14 12  2  0
 15 16  3  0
  9 15  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  4 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
  3 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4099528

    ---

Associated Targets(Human)

RAPGEF3 Tchem Rap guanine nucleotide exchange factor 3 (15528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rapgef4 Rap guanine nucleotide exchange factor 4 (114 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.72Molecular Weight (Monoisotopic): 392.0288AlogP: 4.67#Rotatable Bonds: 4
Polar Surface Area: 91.28Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.71CX Basic pKa: CX LogP: 5.37CX LogD: 3.67
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.40Np Likeness Score: -1.75

References

1. Ye N, Zhu Y, Liu Z, Mei FC, Chen H, Wang P, Cheng X, Zhou J..  (2017)  Identification of novel 2-(benzo[d]isoxazol-3-yl)-2-oxo-N-phenylacetohydrazonoyl cyanide analoguesas potent EPAC antagonists.,  134  [PMID:28399451] [10.1016/j.ejmech.2017.04.001]

Source