6-(3-(1H-imidazol-1yl)propoxy)-2-(4-(3-(1H-imidazol-1-yl)propoxy)phenyl)benzo[d]-oxazole

ID: ALA4099716

PubChem CID: 137659544

Max Phase: Preclinical

Molecular Formula: C25H25N5O3

Molecular Weight: 443.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1cn(CCCOc2ccc(-c3nc4ccc(OCCCn5ccnc5)cc4o3)cc2)cn1

Standard InChI:  InChI=1S/C25H25N5O3/c1(11-29-13-9-26-18-29)15-31-21-5-3-20(4-6-21)25-28-23-8-7-22(17-24(23)33-25)32-16-2-12-30-14-10-27-19-30/h3-10,13-14,17-19H,1-2,11-12,15-16H2

Standard InChI Key:  KJLLRWFPCOJOLG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   12.2498  -13.2470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7299  -12.5813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2498  -11.9197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4726  -12.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4726  -12.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7635  -13.3985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0544  -12.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0544  -12.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7635  -11.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5471  -12.5813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9557  -11.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7729  -11.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1815  -12.5813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7729  -13.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9557  -13.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9987  -12.5813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4073  -11.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9987  -11.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4073  -10.4616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7046   -9.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4819  -10.0530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4819  -10.8702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7046  -11.1191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2245  -10.4616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3494  -13.3985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6403  -12.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9354  -13.3985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2263  -12.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4332  -14.2101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6348  -14.3819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2262  -13.6753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7699  -13.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5172  -13.3985    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  5  6  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 17 18  1  0
 18 19  1  0
 16 17  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 20 24  1  0
 19 24  1  0
 13 16  1  0
  2 10  1  0
 26 27  1  0
 27 28  1  0
 25 26  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 29 33  1  0
 28 33  1  0
  7 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4099716

    ---

Associated Targets(Human)

TLR9 Tclin Toll-like receptor 9 (943 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.51Molecular Weight (Monoisotopic): 443.1957AlogP: 4.83#Rotatable Bonds: 11
Polar Surface Area: 80.13Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.83CX LogP: 2.96CX LogD: 2.88
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.27Np Likeness Score: -1.23

References

1. Roy S, Mukherjee A, Paul B, Rahaman O, Roy S, Maithri G, Ramya B, Pal S, Ganguly D, Talukdar A..  (2017)  Design and development of benzoxazole derivatives with toll-like receptor 9 antagonism.,  134  [PMID:28437629] [10.1016/j.ejmech.2017.03.086]

Source