The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(3-(1H-imidazol-1yl)propoxy)-2-(4-(3-(1H-imidazol-1-yl)propoxy)phenyl)benzo[d]-oxazole ID: ALA4099716
PubChem CID: 137659544
Max Phase: Preclinical
Molecular Formula: C25H25N5O3
Molecular Weight: 443.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: c1cn(CCCOc2ccc(-c3nc4ccc(OCCCn5ccnc5)cc4o3)cc2)cn1
Standard InChI: InChI=1S/C25H25N5O3/c1(11-29-13-9-26-18-29)15-31-21-5-3-20(4-6-21)25-28-23-8-7-22(17-24(23)33-25)32-16-2-12-30-14-10-27-19-30/h3-10,13-14,17-19H,1-2,11-12,15-16H2
Standard InChI Key: KJLLRWFPCOJOLG-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
12.2498 -13.2470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7299 -12.5813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2498 -11.9197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4726 -12.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4726 -12.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7635 -13.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0544 -12.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0544 -12.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7635 -11.7641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5471 -12.5813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9557 -11.8747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7729 -11.8747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1815 -12.5813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7729 -13.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9557 -13.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9987 -12.5813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4073 -11.8747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9987 -11.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4073 -10.4616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7046 -9.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4819 -10.0530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4819 -10.8702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7046 -11.1191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2245 -10.4616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3494 -13.3985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6403 -12.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9354 -13.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2263 -12.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4332 -14.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6348 -14.3819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2262 -13.6753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7699 -13.0684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5172 -13.3985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
4 9 2 0
5 6 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
17 18 1 0
18 19 1 0
16 17 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
20 24 1 0
19 24 1 0
13 16 1 0
2 10 1 0
26 27 1 0
27 28 1 0
25 26 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
29 33 1 0
28 33 1 0
7 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.51Molecular Weight (Monoisotopic): 443.1957AlogP: 4.83#Rotatable Bonds: 11Polar Surface Area: 80.13Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.83CX LogP: 2.96CX LogD: 2.88Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.27Np Likeness Score: -1.23
References 1. Roy S, Mukherjee A, Paul B, Rahaman O, Roy S, Maithri G, Ramya B, Pal S, Ganguly D, Talukdar A.. (2017) Design and development of benzoxazole derivatives with toll-like receptor 9 antagonism., 134 [PMID:28437629 ] [10.1016/j.ejmech.2017.03.086 ]