2-(2-((2-methoxybenzyl)oxy)phenyl)oxazolo[5,4-b]pyridine

ID: ALA4099898

PubChem CID: 137660036

Max Phase: Preclinical

Molecular Formula: C20H16N2O3

Molecular Weight: 332.36

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1COc1ccccc1-c1nc2cccnc2o1

Standard InChI:  InChI=1S/C20H16N2O3/c1-23-17-10-4-2-7-14(17)13-24-18-11-5-3-8-15(18)19-22-16-9-6-12-21-20(16)25-19/h2-12H,13H2,1H3

Standard InChI Key:  PBRVQORSQXPWPY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   15.0012   -7.1898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4098   -7.8989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2270   -7.8989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6356   -7.1898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2270   -6.4849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4098   -6.4849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2028   -7.3606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1188   -8.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8619   -8.5095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4097   -8.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7006   -8.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9915   -8.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9915   -9.4009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7006   -9.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4097   -9.4009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7006   -7.3579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9915   -6.9493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2865   -7.3579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5775   -6.9493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8684   -7.3579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8684   -8.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5775   -8.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2865   -8.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5775   -6.1321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8684   -5.7236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  2  0
  7  8  1  0
  8  9  2  0
  1  7  1  0
  2  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
 24 25  1  0
 19 24  1  0
 16 17  1  0
 11 16  1  0
  8 10  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4099898

    ---

Associated Targets(Human)

SGMS2 Tchem Phosphatidylcholine:ceramide cholinephosphotransferase 2 (194 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SGMS1 Tchem Phosphatidylcholine:ceramide cholinephosphotransferase 1 (149 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 332.36Molecular Weight (Monoisotopic): 332.1161AlogP: 4.48#Rotatable Bonds: 5
Polar Surface Area: 57.38Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.90CX LogD: 3.90
Aromatic Rings: 4Heavy Atoms: 25QED Weighted: 0.54Np Likeness Score: -0.89

References

1. Qi XY, Cao Y, Li YL, Mo MG, Zhou L, Ye DY..  (2017)  Discovery of the selective sphingomyelin synthase 2 inhibitors with the novel structure of oxazolopyridine.,  27  (15): [PMID:28619536] [10.1016/j.bmcl.2017.05.074]

Source