2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 2-bromobenzoate

ID: ALA4100013

PubChem CID: 123784782

Max Phase: Preclinical

Molecular Formula: C13H12BrN3O4

Molecular Weight: 354.16

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccccc1Br

Standard InChI:  InChI=1S/C13H12BrN3O4/c1-9-15-8-12(17(19)20)16(9)6-7-21-13(18)10-4-2-3-5-11(10)14/h2-5,8H,6-7H2,1H3

Standard InChI Key:  HAMBCKOTTQSMEZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
   11.4850  -11.3170    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1436  -10.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8781  -10.0450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0543  -10.0559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8154  -10.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4951  -12.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9301  -11.0661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5346  -10.5117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1100  -11.8674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2119  -12.5380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2221  -13.3593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9389  -13.7632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9490  -14.5845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6456  -13.3417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0377  -11.1082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2416  -14.9968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2513  -15.8173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9687  -16.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6777  -15.7962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6645  -14.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3690  -14.5560    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  5 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 13  1  0
 20 21  1  0
M  CHG  2   7   1   9  -1
M  END

Alternative Forms

  1. Parent:

    ALA4100013

    ---

Associated Targets(non-human)

GUSB Beta-glucuronidase (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 354.16Molecular Weight (Monoisotopic): 353.0011AlogP: 2.72#Rotatable Bonds: 5
Polar Surface Area: 87.26Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.27CX LogP: 2.80CX LogD: 2.80
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.47Np Likeness Score: -1.68

References

1. Salar U, Khan KM, Taha M, Ismail NH, Ali B, Qurat-Ul-Ain, Perveen S, Ghufran M, Wadood A..  (2017)  Biology-oriented drug synthesis (BIODS): In vitro β-glucuronidase inhibitory and in silico studies on 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl aryl carboxylate derivatives.,  125  [PMID:27886546] [10.1016/j.ejmech.2016.11.031]

Source