The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl)amino)butyl)-4-((S)-3-(((R)-1-(naphthalen-1-yl)ethyl)amino)pyrrolidin-1-yl)benzamide ID: ALA4100132
PubChem CID: 137661671
Max Phase: Preclinical
Molecular Formula: C31H42N4O4
Molecular Weight: 534.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](N[C@H]1CCN(c2ccc(C(=O)NCCCCNC(CO)(CO)CO)cc2)C1)c1cccc2ccccc12
Standard InChI: InChI=1S/C31H42N4O4/c1-23(28-10-6-8-24-7-2-3-9-29(24)28)34-26-15-18-35(19-26)27-13-11-25(12-14-27)30(39)32-16-4-5-17-33-31(20-36,21-37)22-38/h2-3,6-14,23,26,33-34,36-38H,4-5,15-22H2,1H3,(H,32,39)/t23-,26+/m1/s1
Standard InChI Key: POGJFRGLUPTRBO-BVAGGSTKSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
10.0663 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2821 -5.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2810 -5.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6959 -5.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9873 -4.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6987 -5.8377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9882 -6.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9867 -7.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6949 -7.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4061 -7.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4041 -6.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1113 -5.8353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8196 -6.2430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1103 -5.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5267 -5.8335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2741 -6.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8201 -5.5550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4106 -4.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6115 -5.0188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6329 -5.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9620 -6.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7740 -6.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2544 -5.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9169 -5.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1059 -4.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4017 -6.6382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9231 -7.3006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5439 -5.2264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2574 -8.0463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7788 -8.7087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1131 -9.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6345 -10.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9689 -10.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4903 -11.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8246 -12.2704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7818 -10.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2604 -10.2833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3717 -11.5645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1889 -11.5667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 7 1 0
6 4 1 0
4 5 2 0
5 2 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 6 2 0
11 12 1 0
12 13 1 0
12 14 1 1
15 13 1 1
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 1 1 0
1 26 1 0
26 27 1 0
1 28 2 0
27 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
33 36 1 0
36 37 1 0
33 38 1 0
38 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.70Molecular Weight (Monoisotopic): 534.3206AlogP: 2.58#Rotatable Bonds: 14Polar Surface Area: 117.09Molecular Species: BASEHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.53CX LogP: 2.00CX LogD: -1.39Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.18Np Likeness Score: -0.89
References 1. Sparks SM, Spearing PK, Diaz CJ, Cowan DJ, Jayawickreme C, Chen G, Rimele TJ, Generaux C, Harston LT, Roller SG.. (2017) Identification of potent, nonabsorbable agonists of the calcium-sensing receptor for GI-specific administration., 27 (20): [PMID:28916340 ] [10.1016/j.bmcl.2017.09.008 ]