The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Benzyl-N-(3-(6-(3-(pyrrolidin-1-yl)propoxy)benzo[d]oxazol-2-yl)phenyl)piperidine-4-amine ID: ALA4100138
PubChem CID: 137661892
Max Phase: Preclinical
Molecular Formula: C32H38N4O2
Molecular Weight: 510.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(CN2CCC(Nc3cccc(-c4nc5ccc(OCCCN6CCCC6)cc5o4)c3)CC2)cc1
Standard InChI: InChI=1S/C32H38N4O2/c1-2-8-25(9-3-1)24-36-19-14-27(15-20-36)33-28-11-6-10-26(22-28)32-34-30-13-12-29(23-31(30)38-32)37-21-7-18-35-16-4-5-17-35/h1-3,6,8-13,22-23,27,33H,4-5,7,14-21,24H2
Standard InChI Key: MZXYYKFMCJEETH-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
16.8277 -10.9579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4191 -11.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6019 -11.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1933 -10.9579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6019 -10.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4191 -10.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3761 -10.9579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9675 -10.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1503 -10.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7417 -9.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1503 -8.8341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9675 -8.8341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3761 -9.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4444 -10.2063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9246 -9.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4444 -8.8832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6672 -9.1362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6672 -9.9534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9581 -10.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2531 -9.9534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2531 -9.1362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9581 -8.7276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5440 -10.3620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8350 -9.9534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1300 -10.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4209 -9.9534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7118 -10.3620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6278 -11.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8294 -11.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4208 -10.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9687 -10.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6449 -10.9579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0535 -11.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8707 -11.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2793 -12.3751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8707 -13.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0535 -13.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6449 -12.3751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
4 7 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
8 13 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
14 18 1 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
18 19 2 0
24 25 1 0
25 26 1 0
23 24 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
27 31 1 0
26 27 1 0
20 23 1 0
10 15 1 0
7 8 1 0
32 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
33 38 2 0
1 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.68Molecular Weight (Monoisotopic): 510.2995AlogP: 6.44#Rotatable Bonds: 10Polar Surface Area: 53.77Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.38CX LogP: 4.90CX LogD: 1.67Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.57
References 1. Roy S, Mukherjee A, Paul B, Rahaman O, Roy S, Maithri G, Ramya B, Pal S, Ganguly D, Talukdar A.. (2017) Design and development of benzoxazole derivatives with toll-like receptor 9 antagonism., 134 [PMID:28437629 ] [10.1016/j.ejmech.2017.03.086 ]