(4S)-4-((S)-2-amino-3-carboxypropanamido)-5-oxo-5-(1-oxo-1-((S)-1-oxo-3-phenylpropan-2-ylamino)hexan-2-ylamino)pentanoic acid

ID: ALA4100180

PubChem CID: 137660044

Max Phase: Preclinical

Molecular Formula: C24H34N4O8

Molecular Weight: 506.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCC(NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@H](C=O)Cc1ccccc1

Standard InChI:  InChI=1S/C24H34N4O8/c1-2-3-9-18(23(35)26-16(14-29)12-15-7-5-4-6-8-15)28-24(36)19(10-11-20(30)31)27-22(34)17(25)13-21(32)33/h4-8,14,16-19H,2-3,9-13,25H2,1H3,(H,26,35)(H,27,34)(H,28,36)(H,30,31)(H,32,33)/t16-,17-,18?,19-/m0/s1

Standard InChI Key:  WVGXVDCSNQQEEL-WPOPZESYSA-N

Molfile:  

     RDKit          2D

 36 36  0  0  0  0  0  0  0  0999 V2000
   15.8919  -11.1173    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6162  -10.6999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3287  -11.9434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3287  -11.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6162   -9.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3253   -9.4704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3253   -8.6354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0432   -9.8842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0546  -10.7064    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7794  -11.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4996   -9.8615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4996  -10.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7794  -11.9358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5021  -12.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5021  -13.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2309  -13.5936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7994  -13.5905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2192  -11.1182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9398  -10.7006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6469  -11.9278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6469  -11.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3674  -10.6922    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0893  -11.1075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8144   -9.8509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8144  -10.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0893  -11.9252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8240  -13.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8144  -12.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5346  -11.9179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2549  -12.3225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2598  -13.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5444  -13.5718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9395   -9.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6538   -9.4630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6536   -8.6380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3678   -8.2254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  9  1  0
 12 18  1  0
 21 22  1  0
  1  2  1  0
  2  4  1  0
  4  3  2  0
  2  5  1  1
  5  6  1  0
  6  7  2  0
  6  8  1  0
  9 10  1  0
 10 12  1  0
 12 11  2  0
 10 13  1  6
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 18 19  1  0
 19 21  1  0
 21 20  2  0
 22 23  1  0
 23 25  1  0
 25 24  2  0
 23 26  1  6
 26 28  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 19 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4100180

    ---

Associated Targets(Human)

CTSG Tchem Cathepsin G (2304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.56Molecular Weight (Monoisotopic): 506.2377AlogP: -0.26#Rotatable Bonds: 17
Polar Surface Area: 204.99Molecular Species: ACIDHBA: 7HBD: 6
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 3.43CX Basic pKa: 8.23CX LogP: -2.89CX LogD: -5.79
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.15Np Likeness Score: 0.53

References

1. Swedberg JE, Li CY, de Veer SJ, Wang CK, Craik DJ..  (2017)  Design of Potent and Selective Cathepsin G Inhibitors Based on the Sunflower Trypsin Inhibitor-1 Scaffold.,  60  (2): [PMID:28045523] [10.1021/acs.jmedchem.6b01509]

Source