The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4S)-4-((S)-2-amino-3-carboxypropanamido)-5-oxo-5-(1-oxo-1-((S)-1-oxo-3-phenylpropan-2-ylamino)hexan-2-ylamino)pentanoic acid ID: ALA4100180
PubChem CID: 137660044
Max Phase: Preclinical
Molecular Formula: C24H34N4O8
Molecular Weight: 506.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC(NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@H](C=O)Cc1ccccc1
Standard InChI: InChI=1S/C24H34N4O8/c1-2-3-9-18(23(35)26-16(14-29)12-15-7-5-4-6-8-15)28-24(36)19(10-11-20(30)31)27-22(34)17(25)13-21(32)33/h4-8,14,16-19H,2-3,9-13,25H2,1H3,(H,26,35)(H,27,34)(H,28,36)(H,30,31)(H,32,33)/t16-,17-,18?,19-/m0/s1
Standard InChI Key: WVGXVDCSNQQEEL-WPOPZESYSA-N
Molfile:
RDKit 2D
36 36 0 0 0 0 0 0 0 0999 V2000
15.8919 -11.1173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6162 -10.6999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3287 -11.9434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3287 -11.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6162 -9.8806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3253 -9.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3253 -8.6354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0432 -9.8842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0546 -10.7064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7794 -11.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4996 -9.8615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4996 -10.6992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7794 -11.9358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5021 -12.3547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5021 -13.1737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2309 -13.5936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7994 -13.5905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2192 -11.1182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9398 -10.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6469 -11.9278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6469 -11.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3674 -10.6922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0893 -11.1075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8144 -9.8509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8144 -10.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0893 -11.9252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8240 -13.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8144 -12.3455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5346 -11.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2549 -12.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2598 -13.1516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5444 -13.5718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9395 -9.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6538 -9.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6536 -8.6380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3678 -8.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 9 1 0
12 18 1 0
21 22 1 0
1 2 1 0
2 4 1 0
4 3 2 0
2 5 1 1
5 6 1 0
6 7 2 0
6 8 1 0
9 10 1 0
10 12 1 0
12 11 2 0
10 13 1 6
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
18 19 1 0
19 21 1 0
21 20 2 0
22 23 1 0
23 25 1 0
25 24 2 0
23 26 1 6
26 28 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
19 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.56Molecular Weight (Monoisotopic): 506.2377AlogP: -0.26#Rotatable Bonds: 17Polar Surface Area: 204.99Molecular Species: ACIDHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.43CX Basic pKa: 8.23CX LogP: -2.89CX LogD: -5.79Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.15Np Likeness Score: 0.53
References 1. Swedberg JE, Li CY, de Veer SJ, Wang CK, Craik DJ.. (2017) Design of Potent and Selective Cathepsin G Inhibitors Based on the Sunflower Trypsin Inhibitor-1 Scaffold., 60 (2): [PMID:28045523 ] [10.1021/acs.jmedchem.6b01509 ]