3-Demethoxycarbonyl-3-ethoxymethyl-4-deacetyl-4-isobutyryloxyl vindoline

ID: ALA4100361

PubChem CID: 137660273

Max Phase: Preclinical

Molecular Formula: C28H40N2O5

Molecular Weight: 484.64

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC[C@@]1(O)[C@H](OC(=O)C(C)C)[C@]2(CC)C=CCN3CC[C@@]4(c5ccc(OC)cc5N(C)[C@@H]14)[C@@H]32

Standard InChI:  InChI=1S/C28H40N2O5/c1-7-26-12-9-14-30-15-13-27(23(26)30)20-11-10-19(33-6)16-21(20)29(5)24(27)28(32,17-34-8-2)25(26)35-22(31)18(3)4/h9-12,16,18,23-25,32H,7-8,13-15,17H2,1-6H3/t23-,24+,25+,26+,27+,28-/m0/s1

Standard InChI Key:  KLUGLEFVHPPQKQ-YBMFQFDFSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    6.9732   -7.6329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0066   -7.8795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0570   -9.8237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7068   -6.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0524   -6.8752    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5148   -7.3890    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8992   -9.1198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7615   -8.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4184   -7.1645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7533   -7.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1324   -7.3269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6147   -8.7091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8181   -6.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6373   -6.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4700   -9.1137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8783   -9.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4688   -6.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7278   -9.7507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2978   -6.6491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1857   -7.8804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9137   -6.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7574   -9.5304    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1746   -6.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4897   -8.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4697   -7.4645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9784   -8.9646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6744   -8.2177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1857   -8.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8786   -7.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3359   -7.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6168   -7.8919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3214   -9.1194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6955   -9.8290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1017  -10.5381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6908  -11.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0301   -8.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3194   -9.9366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4 21  1  0
  6 23  1  0
 25 19  1  0
 24 26  1  0
 20  2  1  6
  2  9  1  0
 15 28  1  0
 24  1  2  0
 10 11  1  1
 30 27  2  0
 26 18  1  0
 20 29  1  0
  3 15  1  0
 29  4  2  0
 26  8  1  0
 30  6  1  0
  8 10  1  0
 27 24  1  0
 15 16  1  6
 25  5  1  6
 17 11  1  0
 13 30  1  0
 19 17  1  0
  7 12  1  0
 19 21  1  0
  8 15  1  0
  8 22  1  1
 10  1  1  0
 14 13  2  0
 25 20  1  0
 28 20  1  0
  1 14  1  0
 10 25  1  0
 28  7  1  1
 12 31  2  0
 12 32  1  0
 16 33  1  0
 33 34  1  0
 34 35  1  0
 32 36  1  0
 32 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4100361

    ---

Associated Targets(non-human)

MIN6 (162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.64Molecular Weight (Monoisotopic): 484.2937AlogP: 3.14#Rotatable Bonds: 7
Polar Surface Area: 71.47Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.44CX Basic pKa: 8.81CX LogP: 3.51CX LogD: 2.09
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.47Np Likeness Score: 1.85

References

1. Xiao C, Tian Y, Lei M, Chen F, Gan X, Yao X, Shen X, Chen J, Hu L..  (2017)  Synthesis and glucose-stimulate insulin secretion (GSIS) evaluation of vindoline derivatives.,  27  (5): [PMID:28162858] [10.1016/j.bmcl.2016.09.064]

Source