The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-hydroxy-3-(4-(2-oxo-2-(phenyl(quinolin-2-ylmethyl)amino)ethyl)phenyl)acrylamide ID: ALA4100551
PubChem CID: 137660283
Max Phase: Preclinical
Molecular Formula: C27H23N3O3
Molecular Weight: 437.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccc(CC(=O)N(Cc2ccc3ccccc3n2)c2ccccc2)cc1)NO
Standard InChI: InChI=1S/C27H23N3O3/c31-26(29-33)17-14-20-10-12-21(13-11-20)18-27(32)30(24-7-2-1-3-8-24)19-23-16-15-22-6-4-5-9-25(22)28-23/h1-17,33H,18-19H2,(H,29,31)/b17-14+
Standard InChI Key: SINZMDZRQPPYER-SAPNQHFASA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
0.3453 -26.9136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3441 -27.7332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0522 -28.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0504 -26.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7590 -26.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7598 -27.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4683 -28.1361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1766 -27.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1718 -26.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4627 -26.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8858 -28.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5920 -27.7198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3013 -28.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0074 -27.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7116 -28.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5854 -26.9013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2932 -26.4881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2870 -25.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5743 -25.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8664 -25.6854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8761 -26.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3044 -28.9428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7063 -28.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4097 -29.3468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1167 -28.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1159 -28.1228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4120 -27.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8240 -29.3505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5321 -28.9426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2394 -29.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9475 -28.9439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2387 -30.1690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6549 -29.3531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
12 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
13 22 2 0
15 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 15 1 0
25 28 1 0
28 29 2 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.50Molecular Weight (Monoisotopic): 437.1739AlogP: 4.53#Rotatable Bonds: 7Polar Surface Area: 82.53Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.56CX Basic pKa: 3.52CX LogP: 4.23CX LogD: 4.22Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.25Np Likeness Score: -0.89
References 1. Chen C, Hou X, Wang G, Pan W, Yang X, Zhang Y, Fang H.. (2017) Design, synthesis and biological evaluation of quinoline derivatives as HDAC class I inhibitors., 133 [PMID:28371677 ] [10.1016/j.ejmech.2017.03.064 ]