(E)-N-hydroxy-3-(4-(2-oxo-2-(phenyl(quinolin-2-ylmethyl)amino)ethyl)phenyl)acrylamide

ID: ALA4100551

PubChem CID: 137660283

Max Phase: Preclinical

Molecular Formula: C27H23N3O3

Molecular Weight: 437.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccc(CC(=O)N(Cc2ccc3ccccc3n2)c2ccccc2)cc1)NO

Standard InChI:  InChI=1S/C27H23N3O3/c31-26(29-33)17-14-20-10-12-21(13-11-20)18-27(32)30(24-7-2-1-3-8-24)19-23-16-15-22-6-4-5-9-25(22)28-23/h1-17,33H,18-19H2,(H,29,31)/b17-14+

Standard InChI Key:  SINZMDZRQPPYER-SAPNQHFASA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    0.3453  -26.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3441  -27.7332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0522  -28.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0504  -26.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7590  -26.9100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7598  -27.7290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4683  -28.1361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1766  -27.7253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1718  -26.9031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4627  -26.4998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8858  -28.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5920  -27.7198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3013  -28.1256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0074  -27.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7116  -28.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5854  -26.9013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2932  -26.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2870  -25.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5743  -25.2661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8664  -25.6854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8761  -26.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3044  -28.9428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7063  -28.9382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4097  -29.3468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1167  -28.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1159  -28.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4120  -27.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8240  -29.3505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5321  -28.9426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2394  -29.3518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9475  -28.9439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2387  -30.1690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6549  -29.3531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 12 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 13 22  2  0
 15 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 15  1  0
 25 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 30 32  2  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4100551

    ---

Associated Targets(Human)

HDAC1 Tclin Histone deacetylase (HDAC1 and HDAC2) (618 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.50Molecular Weight (Monoisotopic): 437.1739AlogP: 4.53#Rotatable Bonds: 7
Polar Surface Area: 82.53Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.56CX Basic pKa: 3.52CX LogP: 4.23CX LogD: 4.22
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.25Np Likeness Score: -0.89

References

1. Chen C, Hou X, Wang G, Pan W, Yang X, Zhang Y, Fang H..  (2017)  Design, synthesis and biological evaluation of quinoline derivatives as HDAC class I inhibitors.,  133  [PMID:28371677] [10.1016/j.ejmech.2017.03.064]

Source