The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((((5-(Aminomethyl)-6-isobutyl-2-methyl-4-(4-methylphenyl)pyridin-3-yl)carbonyl)oxy)methyl)benzoic acid dihydrochloride ID: ALA4100667
PubChem CID: 69446993
Max Phase: Preclinical
Molecular Formula: C27H32Cl2N2O4
Molecular Weight: 446.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2c(CN)c(CC(C)C)nc(C)c2C(=O)OCc2ccc(C(=O)O)cc2)cc1.Cl.Cl
Standard InChI: InChI=1S/C27H30N2O4.2ClH/c1-16(2)13-23-22(14-28)25(20-9-5-17(3)6-10-20)24(18(4)29-23)27(32)33-15-19-7-11-21(12-8-19)26(30)31;;/h5-12,16H,13-15,28H2,1-4H3,(H,30,31);2*1H
Standard InChI Key: QETFKWTUKGFJOU-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 35 0 0 0 0 0 0 0 0999 V2000
27.3663 -30.4708 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.9951 -27.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9939 -28.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7065 -28.6530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7047 -26.9970 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4219 -27.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4227 -28.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7092 -29.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9963 -29.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9980 -30.7135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7116 -31.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4294 -30.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4243 -29.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7146 -31.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2773 -28.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5613 -28.2362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2787 -26.9974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2785 -26.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5620 -25.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9947 -25.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1374 -26.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1364 -28.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1396 -29.4640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8471 -28.2279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5609 -28.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2715 -28.2224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9807 -28.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6892 -28.2216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6904 -27.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9768 -26.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2621 -27.4002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4026 -26.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1147 -27.3989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4026 -26.1653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6791 -30.8082 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 8 1 0
11 14 1 0
3 15 1 0
15 16 1 0
2 17 1 0
17 18 1 0
18 19 1 0
18 20 1 0
6 21 1 0
7 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
26 25 1 0
26 27 2 0
26 31 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
29 32 1 0
32 33 2 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.55Molecular Weight (Monoisotopic): 446.2206AlogP: 5.08#Rotatable Bonds: 8Polar Surface Area: 102.51Molecular Species: ZWITTERIONHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.20CX Basic pKa: 9.12CX LogP: 2.86CX LogD: 2.85Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -0.35
References 1. Maezaki H, Tawada M, Yamashita T, Banno Y, Miyamoto Y, Yamamoto Y, Ikedo K, Kosaka T, Tsubotani S, Tani A, Asakawa T, Suzuki N, Oi S.. (2017) Design of potent dipeptidyl peptidase IV (DPP-4) inhibitors by employing a strategy to form a salt bridge with Lys554., 27 (15): [PMID:28579121 ] [10.1016/j.bmcl.2017.05.048 ]