4-((((5-(Aminomethyl)-6-isobutyl-2-methyl-4-(4-methylphenyl)pyridin-3-yl)carbonyl)oxy)methyl)benzoic acid dihydrochloride

ID: ALA4100667

PubChem CID: 69446993

Max Phase: Preclinical

Molecular Formula: C27H32Cl2N2O4

Molecular Weight: 446.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2c(CN)c(CC(C)C)nc(C)c2C(=O)OCc2ccc(C(=O)O)cc2)cc1.Cl.Cl

Standard InChI:  InChI=1S/C27H30N2O4.2ClH/c1-16(2)13-23-22(14-28)25(20-9-5-17(3)6-10-20)24(18(4)29-23)27(32)33-15-19-7-11-21(12-8-19)26(30)31;;/h5-12,16H,13-15,28H2,1-4H3,(H,30,31);2*1H

Standard InChI Key:  QETFKWTUKGFJOU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 35  0  0  0  0  0  0  0  0999 V2000
   27.3663  -30.4708    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   21.9951  -27.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9939  -28.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7065  -28.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7047  -26.9970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4219  -27.4048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4227  -28.2332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7092  -29.4755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9963  -29.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9980  -30.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7116  -31.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4294  -30.7067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4243  -29.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7146  -31.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2773  -28.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5613  -28.2362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2787  -26.9974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2785  -26.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5620  -25.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9947  -25.7554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1374  -26.9919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1364  -28.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1396  -29.4640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8471  -28.2279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5609  -28.6363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2715  -28.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9807  -28.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6892  -28.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6904  -27.3988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9768  -26.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2621  -27.4002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4026  -26.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1147  -27.3989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.4026  -26.1653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6791  -30.8082    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  4  8  1  0
 11 14  1  0
  3 15  1  0
 15 16  1  0
  2 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
  6 21  1  0
  7 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 26 25  1  0
 26 27  2  0
 26 31  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 29 32  1  0
 32 33  2  0
 32 34  1  0
M  END

Associated Targets(Human)

DPP8 Tchem Dipeptidyl peptidase VIII (2139 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DPP4 Tclin Dipeptidyl peptidase IV (7109 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.55Molecular Weight (Monoisotopic): 446.2206AlogP: 5.08#Rotatable Bonds: 8
Polar Surface Area: 102.51Molecular Species: ZWITTERIONHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.20CX Basic pKa: 9.12CX LogP: 2.86CX LogD: 2.85
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -0.35

References

1. Maezaki H, Tawada M, Yamashita T, Banno Y, Miyamoto Y, Yamamoto Y, Ikedo K, Kosaka T, Tsubotani S, Tani A, Asakawa T, Suzuki N, Oi S..  (2017)  Design of potent dipeptidyl peptidase IV (DPP-4) inhibitors by employing a strategy to form a salt bridge with Lys554.,  27  (15): [PMID:28579121] [10.1016/j.bmcl.2017.05.048]

Source