(1S,2R)-N-hydroxy-1-ethyl-2-[methyl((4-[(2-methylquinolin-4-yl)methoxy]phenyl}sulfonyl)amino]cyclopentanecarboxamide

ID: ALA4100973

PubChem CID: 11856679

Max Phase: Preclinical

Molecular Formula: C26H31N3O5S

Molecular Weight: 497.62

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC[C@]1(C(=O)NO)CCC[C@H]1N(C)S(=O)(=O)c1ccc(OCc2cc(C)nc3ccccc23)cc1

Standard InChI:  InChI=1S/C26H31N3O5S/c1-4-26(25(30)28-31)15-7-10-24(26)29(3)35(32,33)21-13-11-20(12-14-21)34-17-19-16-18(2)27-23-9-6-5-8-22(19)23/h5-6,8-9,11-14,16,24,31H,4,7,10,15,17H2,1-3H3,(H,28,30)/t24-,26+/m1/s1

Standard InChI Key:  HSFNYQQMBCDKTR-RSXGOPAZSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    8.5455   -9.8164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9622  -10.5330    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.3745   -9.8139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8190   -9.6955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8179  -10.5229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5326  -10.9357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5308   -9.2828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2463   -9.6918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2470  -10.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9623  -10.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6772  -10.5149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6725   -9.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9567   -9.2777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1044   -9.2832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5345  -11.7606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8211  -12.1747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1057  -11.7640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1084  -10.9397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3938  -10.5290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6794  -10.9432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6839  -11.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2504  -10.9484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2535  -11.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5931  -12.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8509  -13.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6759  -13.0415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9278  -12.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1748  -11.5413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5850  -10.8256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3498  -11.5438    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9352  -10.8306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7915  -12.4704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4006  -12.1810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2116  -11.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5343  -10.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  4 14  1  0
  6 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 33 17  1  0
 20  2  1  0
  2 22  1  0
 23 22  1  6
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 23  1  0
 24 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 24 32  1  1
 21 33  2  0
 32 34  1  0
 22 35  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4100973

   (1S,2R)-1-ethyl-N-hydroxy-2-[methyl-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]cyclopentane-1-carboxamide

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 497.62

Molecular Weight (Monoisotopic): 497.1984

AlogP: 4.20

#Rotatable Bonds: 8

Polar Surface Area: 108.83

Molecular Species: NEUTRAL

HBA: 6

HBD: 2

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 2

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 8.82

CX Basic pKa: 5.02

CX LogP: 3.81

CX LogD: 3.79

Aromatic Rings: 3

Heavy Atoms: 35

QED Weighted: 0.36

Np Likeness Score: -0.64

References

1. Ouvry G, Berton Y, Bhurruth-Alcor Y, Bonnary L, Bouix-Peter C, Bouquet K, Bourotte M, Chambon S, Comino C, Deprez B, Duvert D, Duvert G, Hacini-Rachinel F, Harris CS, Luzy AP, Mathieu A, Millois C, Pascau J, Pinto A, Polge G, Reitz A, Reversé K, Rosignoli C, Taquet N, Hennequin LF..  (2017)  Identification of novel TACE inhibitors compatible with topical application.,  27  (8): [PMID:28274635] [10.1016/j.bmcl.2017.02.035]

Source

Source(1):

• Scientific Literature