Sodium (8S,11S)-8-(cyclohexylmethyl)-12-hydroxy-6,9-dioxo-11-(((S)-2-oxo-pyrrolidin-3-yl)methyl)-1-phenyl-2,5-dioxa-7,10-diazadodecane-12-sulfonate

ID: ALA4101004

PubChem CID: 137659845

Max Phase: Preclinical

Molecular Formula: C26H38N3NaO9S

Molecular Weight: 569.68

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N[C@@H](CC1CCCCC1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(O)S(=O)(=O)[O-])OCCOCc1ccccc1.[Na+]

Standard InChI:  InChI=1S/C26H39N3O9S.Na/c30-23-20(11-12-27-23)16-22(25(32)39(34,35)36)28-24(31)21(15-18-7-3-1-4-8-18)29-26(33)38-14-13-37-17-19-9-5-2-6-10-19;/h2,5-6,9-10,18,20-22,25,32H,1,3-4,7-8,11-17H2,(H,27,30)(H,28,31)(H,29,33)(H,34,35,36);/q;+1/p-1/t20-,21-,22-,25?;/m0./s1

Standard InChI Key:  GNBAPFQUNCJYFP-FLABFKKQSA-M

Molfile:  

     RDKit          2D

 41 42  0  0  0  0  0  0  0  0999 V2000
   24.8734  -20.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8205  -18.7704    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.3826  -16.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2369  -17.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4073  -19.4685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6735  -15.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3827  -17.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8323  -21.2671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2914  -21.4725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9602  -21.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5167  -18.7492    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3826  -19.5838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9462  -19.5838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2370  -18.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9459  -17.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0743  -17.4869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5410  -18.3677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7962  -19.3448    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.1022  -18.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9458  -16.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2311  -19.4683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.3828  -18.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6165  -21.0081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6737  -18.3662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6736  -17.5510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9461  -18.7749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7053  -20.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8089  -18.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0998  -18.7443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8116  -17.5208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3935  -18.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6844  -18.7396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9781  -18.3287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2690  -18.7350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5627  -18.3241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5682  -17.5092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8626  -17.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1526  -17.5047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1525  -18.3261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8587  -18.7332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9581  -17.1229    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
  2 17  1  0
 26 24  1  0
  4 15  1  0
  1 12  1  6
  9 23  1  0
 20  6  1  0
 15 20  1  0
 14 11  1  0
  2 21  2  0
  6  3  1  0
 27 10  1  0
 19 16  1  0
 24 22  1  0
 23  1  1  0
  1 27  1  0
 19  2  1  0
  7 25  1  0
 26 14  1  0
  9 10  1  0
 22 19  1  0
 23  8  2  0
 14  4  1  1
  3  7  1  0
  5  2  2  0
 22 18  1  1
 22 12  1  0
 26 13  2  0
 15 25  1  0
 11 28  1  0
 28 29  1  0
 28 30  2  0
 29 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 35  1  0
M  CHG  2  17  -1  41   1
M  END

Associated Targets(non-human)

Norovirus (313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 569.68Molecular Weight (Monoisotopic): 569.2407AlogP: 1.49#Rotatable Bonds: 14
Polar Surface Area: 180.36Molecular Species: ACIDHBA: 8HBD: 5
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: -1.14CX Basic pKa: CX LogP: 0.19CX LogD: -1.02
Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.16Np Likeness Score: 0.06

References

1. Galasiti Kankanamalage AC, Kim Y, Rathnayake AD, Damalanka VC, Weerawarna PM, Doyle ST, Alsoudi AF, Dissanayake DMP, Lushington GH, Mehzabeen N, Battaile KP, Lovell S, Chang KO, Groutas WC..  (2017)  Structure-based exploration and exploitation of the S4 subsite of norovirus 3CL protease in the design of potent and permeable inhibitors.,  126  [PMID:27914364] [10.1016/j.ejmech.2016.11.027]

Source