The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
25,27-bis-[N-(2-hydroxyethyl)aminocarbonylmethoxyl]-calix[4]arene-26,28-diol ID: ALA4101048
PubChem CID: 101144186
Max Phase: Preclinical
Molecular Formula: C36H38N2O8
Molecular Weight: 626.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COc1c2cccc1Cc1cccc(c1O)Cc1cccc(c1OCC(=O)NCCO)Cc1cccc(c1O)C2)NCCO
Standard InChI: InChI=1S/C36H38N2O8/c39-15-13-37-31(41)21-45-35-27-9-3-11-29(35)19-25-7-2-8-26(34(25)44)20-30-12-4-10-28(36(30)46-22-32(42)38-14-16-40)18-24-6-1-5-23(17-27)33(24)43/h1-12,39-40,43-44H,13-22H2,(H,37,41)(H,38,42)
Standard InChI Key: SOJZZMHXCQIOFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 50 0 0 0 0 0 0 0 0999 V2000
3.1080 -19.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2887 -19.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8631 -19.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2555 -20.4813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0780 -20.4980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5000 -19.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3170 -19.8161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5414 -23.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5403 -24.1507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2484 -24.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9580 -24.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9552 -23.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2466 -22.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2441 -22.1051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1265 -22.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2866 -18.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4673 -19.0121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0733 -19.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4975 -20.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3200 -20.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7102 -19.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2563 -19.7456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6936 -16.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6879 -17.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4507 -15.7453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4495 -16.5649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1576 -16.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8672 -16.5644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8644 -15.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1558 -15.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1574 -17.7910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5329 -22.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7402 -19.1170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5572 -19.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9804 -18.4349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9511 -19.8500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7975 -18.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2206 -17.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0377 -17.7698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8625 -20.4616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0454 -20.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6516 -21.1947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6222 -19.7795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8346 -21.2116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4408 -21.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6238 -21.9447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
13 14 1 0
12 15 1 0
8 32 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
18 22 1 0
19 15 1 0
17 23 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
27 31 1 0
26 24 1 0
28 23 1 0
1 24 1 0
5 32 1 0
7 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 1 0
38 39 1 0
22 40 1 0
40 41 1 0
41 42 1 0
41 43 2 0
42 44 1 0
44 45 1 0
45 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 626.71Molecular Weight (Monoisotopic): 626.2628AlogP: 2.75#Rotatable Bonds: 10Polar Surface Area: 157.58Molecular Species: NEUTRALHBA: 8HBD: 6#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.80CX Basic pKa: ┄CX LogP: 3.85CX LogD: 3.85Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.14Np Likeness Score: -0.14
References 1. An L, Han LL, Zheng YG, Peng XN, Xue YS, Gu XK, Sun J, Yan CG.. (2016) Synthesis, X-ray crystal structure and anti-tumor activity of calix[n]arene polyhydroxyamine derivatives., 123 [PMID:27474920 ] [10.1016/j.ejmech.2016.07.016 ]