7alpha-Benzyl-3-methoxynaltrexone

ID: ALA4101073

PubChem CID: 137659367

Max Phase: Preclinical

Molecular Formula: C28H31NO4

Molecular Weight: 445.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c3c1O[C@H]1C(=O)C(Cc4ccccc4)C[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314

Standard InChI:  InChI=1S/C28H31NO4/c1-32-21-10-9-19-14-22-28(31)15-20(13-17-5-3-2-4-6-17)24(30)26-27(28,23(19)25(21)33-26)11-12-29(22)16-18-7-8-18/h2-6,9-10,18,20,22,26,31H,7-8,11-16H2,1H3/t20?,22-,26+,27+,28-/m1/s1

Standard InChI Key:  CNWCUWCDLTXWOT-CQLBRJSVSA-N

Molfile:  

     RDKit          2D

 35 41  0  0  0  0  0  0  0  0999 V2000
   27.2108  -20.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6153  -20.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4019  -20.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6029  -21.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0098  -21.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7692  -22.1550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1861  -19.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2108  -18.7748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0098  -20.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4019  -19.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7940  -20.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4242  -20.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4118  -21.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6153  -18.0608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2009  -21.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7940  -19.2907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4242  -18.0525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1300  -18.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1217  -17.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2009  -20.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8287  -20.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0198  -19.5713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8163  -22.3943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7923  -20.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7840  -22.3902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8918  -19.1792    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.6029  -22.5759    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.6459  -20.9882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0591  -20.2832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8753  -20.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2885  -19.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8845  -18.8763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0631  -18.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6536  -19.5783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9668  -22.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  1  1  0
  5  3  2  0
  6  4  1  0
  7  2  1  0
  8 16  1  0
  9  3  1  0
 10  9  1  0
  1 11  1  1
 12  2  1  0
 13  4  1  0
 14  8  1  0
 15  5  1  0
 16 11  1  0
 17 14  1  0
 18 17  1  0
 19 17  1  0
 20  9  2  0
 21 13  1  0
  2 22  1  1
 23 13  2  0
 24 20  1  0
 25 15  1  0
  7 26  1  6
  4 27  1  1
  5  6  1  0
  8  7  1  0
 21 12  1  0
 10  7  1  0
 24 15  2  0
 18 19  1  0
 21 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 25 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4101073

    ---

Associated Targets(non-human)

Trichomonas vaginalis (2376 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.56Molecular Weight (Monoisotopic): 445.2253AlogP: 3.30#Rotatable Bonds: 5
Polar Surface Area: 59.00Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.56CX Basic pKa: 8.94CX LogP: 3.94CX LogD: 2.39
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.77Np Likeness Score: 1.06

References

1. Kutsumura N, Koyama Y, Nagumo Y, Nakajima R, Miyata Y, Yamamoto N, Saitoh T, Yoshida N, Iwata S, Nagase H..  (2017)  Antitrichomonal activity of δ opioid receptor antagonists, 7-benzylidenenaltrexone derivatives.,  25  (16): [PMID:28662966] [10.1016/j.bmc.2017.06.026]

Source