The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7alpha-Benzyl-3-methoxynaltrexone ID: ALA4101073
PubChem CID: 137659367
Max Phase: Preclinical
Molecular Formula: C28H31NO4
Molecular Weight: 445.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c3c1O[C@H]1C(=O)C(Cc4ccccc4)C[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314
Standard InChI: InChI=1S/C28H31NO4/c1-32-21-10-9-19-14-22-28(31)15-20(13-17-5-3-2-4-6-17)24(30)26-27(28,23(19)25(21)33-26)11-12-29(22)16-18-7-8-18/h2-6,9-10,18,20,22,26,31H,7-8,11-16H2,1H3/t20?,22-,26+,27+,28-/m1/s1
Standard InChI Key: CNWCUWCDLTXWOT-CQLBRJSVSA-N
Molfile:
RDKit 2D
35 41 0 0 0 0 0 0 0 0999 V2000
27.2108 -20.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6153 -20.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4019 -20.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6029 -21.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0098 -21.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7692 -22.1550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1861 -19.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2108 -18.7748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0098 -20.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4019 -19.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7940 -20.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4242 -20.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4118 -21.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6153 -18.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2009 -21.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7940 -19.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4242 -18.0525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1300 -18.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1217 -17.6356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2009 -20.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8287 -20.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0198 -19.5713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8163 -22.3943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7923 -20.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7840 -22.3902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8918 -19.1792 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
27.6029 -22.5759 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
29.6459 -20.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0591 -20.2832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8753 -20.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2885 -19.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8845 -18.8763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0631 -18.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6536 -19.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9668 -22.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 1 0
5 3 2 0
6 4 1 0
7 2 1 0
8 16 1 0
9 3 1 0
10 9 1 0
1 11 1 1
12 2 1 0
13 4 1 0
14 8 1 0
15 5 1 0
16 11 1 0
17 14 1 0
18 17 1 0
19 17 1 0
20 9 2 0
21 13 1 0
2 22 1 1
23 13 2 0
24 20 1 0
25 15 1 0
7 26 1 6
4 27 1 1
5 6 1 0
8 7 1 0
21 12 1 0
10 7 1 0
24 15 2 0
18 19 1 0
21 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
25 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.56Molecular Weight (Monoisotopic): 445.2253AlogP: 3.30#Rotatable Bonds: 5Polar Surface Area: 59.00Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.56CX Basic pKa: 8.94CX LogP: 3.94CX LogD: 2.39Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.77Np Likeness Score: 1.06
References 1. Kutsumura N, Koyama Y, Nagumo Y, Nakajima R, Miyata Y, Yamamoto N, Saitoh T, Yoshida N, Iwata S, Nagase H.. (2017) Antitrichomonal activity of δ opioid receptor antagonists, 7-benzylidenenaltrexone derivatives., 25 (16): [PMID:28662966 ] [10.1016/j.bmc.2017.06.026 ]