The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-((1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl)amino)ethyl)-4-((S)-3-(((R)-1-(naphthalen-1-yl)ethyl)amino)pyrrolidin-1-yl)benzamide ID: ALA4101097
PubChem CID: 137660522
Max Phase: Preclinical
Molecular Formula: C29H38N4O4
Molecular Weight: 506.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](N[C@H]1CCN(c2ccc(C(=O)NCCNC(CO)(CO)CO)cc2)C1)c1cccc2ccccc12
Standard InChI: InChI=1S/C29H38N4O4/c1-21(26-8-4-6-22-5-2-3-7-27(22)26)32-24-13-16-33(17-24)25-11-9-23(10-12-25)28(37)30-14-15-31-29(18-34,19-35)20-36/h2-12,21,24,31-32,34-36H,13-20H2,1H3,(H,30,37)/t21-,24+/m1/s1
Standard InChI Key: PEZGIIPBJJMUFY-QPPBQGQZSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
12.8852 -5.7368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1010 -4.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0999 -5.6855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5148 -4.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8062 -4.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5176 -5.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8071 -6.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8056 -6.9094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5138 -7.3201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2250 -6.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2230 -6.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9302 -5.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6385 -6.0903 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9292 -4.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3456 -5.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0930 -6.0103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6390 -5.4023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2294 -4.6951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4304 -4.8661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4518 -5.4867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7809 -6.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5929 -6.3188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0733 -5.6566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7358 -4.9077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9248 -4.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2206 -6.4855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7420 -7.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3628 -5.0737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0763 -7.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5977 -8.5559 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9320 -9.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4534 -9.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7450 -9.3849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2236 -8.7225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7878 -10.7097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3351 -10.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1523 -10.0068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 7 1 0
6 4 1 0
4 5 2 0
5 2 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 6 2 0
11 12 1 0
12 13 1 0
12 14 1 1
15 13 1 1
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 1 1 0
1 26 1 0
26 27 1 0
1 28 2 0
27 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
33 34 1 0
32 35 1 0
31 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.65Molecular Weight (Monoisotopic): 506.2893AlogP: 1.80#Rotatable Bonds: 12Polar Surface Area: 117.09Molecular Species: BASEHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.47CX LogP: 1.42CX LogD: -1.37Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.21Np Likeness Score: -0.93
References 1. Sparks SM, Spearing PK, Diaz CJ, Cowan DJ, Jayawickreme C, Chen G, Rimele TJ, Generaux C, Harston LT, Roller SG.. (2017) Identification of potent, nonabsorbable agonists of the calcium-sensing receptor for GI-specific administration., 27 (20): [PMID:28916340 ] [10.1016/j.bmcl.2017.09.008 ]