N-(2-((1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl)amino)ethyl)-4-((S)-3-(((R)-1-(naphthalen-1-yl)ethyl)amino)pyrrolidin-1-yl)benzamide

ID: ALA4101097

PubChem CID: 137660522

Max Phase: Preclinical

Molecular Formula: C29H38N4O4

Molecular Weight: 506.65

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H](N[C@H]1CCN(c2ccc(C(=O)NCCNC(CO)(CO)CO)cc2)C1)c1cccc2ccccc12

Standard InChI:  InChI=1S/C29H38N4O4/c1-21(26-8-4-6-22-5-2-3-7-27(22)26)32-24-13-16-33(17-24)25-11-9-23(10-12-25)28(37)30-14-15-31-29(18-34,19-35)20-36/h2-12,21,24,31-32,34-36H,13-20H2,1H3,(H,30,37)/t21-,24+/m1/s1

Standard InChI Key:  PEZGIIPBJJMUFY-QPPBQGQZSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   12.8852   -5.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1010   -4.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0999   -5.6855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5148   -4.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8062   -4.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5176   -5.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8071   -6.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8056   -6.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5138   -7.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2250   -6.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2230   -6.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9302   -5.6826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6385   -6.0903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9292   -4.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3456   -5.6808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0930   -6.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6390   -5.4023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2294   -4.6951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4304   -4.8661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4518   -5.4867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7809   -6.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5929   -6.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0733   -5.6566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7358   -4.9077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9248   -4.8266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2206   -6.4855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7420   -7.1479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3628   -5.0737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0763   -7.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5977   -8.5559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9320   -9.3016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4534   -9.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7450   -9.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2236   -8.7225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7878  -10.7097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3351  -10.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1523  -10.0068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  7  1  0
  6  4  1  0
  4  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  6  2  0
 11 12  1  0
 12 13  1  0
 12 14  1  1
 15 13  1  1
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 17 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23  1  1  0
  1 26  1  0
 26 27  1  0
  1 28  2  0
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 32 35  1  0
 31 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4101097

    ---

Associated Targets(Human)

CASR Tclin Calcium sensing receptor (766 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.65Molecular Weight (Monoisotopic): 506.2893AlogP: 1.80#Rotatable Bonds: 12
Polar Surface Area: 117.09Molecular Species: BASEHBA: 7HBD: 6
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.47CX LogP: 1.42CX LogD: -1.37
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.21Np Likeness Score: -0.93

References

1. Sparks SM, Spearing PK, Diaz CJ, Cowan DJ, Jayawickreme C, Chen G, Rimele TJ, Generaux C, Harston LT, Roller SG..  (2017)  Identification of potent, nonabsorbable agonists of the calcium-sensing receptor for GI-specific administration.,  27  (20): [PMID:28916340] [10.1016/j.bmcl.2017.09.008]

Source