2-(2-(Furan-2-yl)-1,2-dihydro-4-oxoquinazolin-3(4H)-yl)-N'-((furan-2-yl)methylene)-3-phenylpropanehydrazide

ID: ALA4101171

PubChem CID: 137659372

Max Phase: Preclinical

Molecular Formula: C26H22N4O4

Molecular Weight: 454.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N/N=C/c1ccco1)C(Cc1ccccc1)N1C(=O)c2ccccc2NC1c1ccco1

Standard InChI:  InChI=1S/C26H22N4O4/c31-25(29-27-17-19-10-6-14-33-19)22(16-18-8-2-1-3-9-18)30-24(23-13-7-15-34-23)28-21-12-5-4-11-20(21)26(30)32/h1-15,17,22,24,28H,16H2,(H,29,31)/b27-17+

Standard InChI Key:  VZFASXHROUMMPU-WPWMEQJKSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    2.4378   -3.3760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4366   -4.1956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1447   -4.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1429   -2.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8515   -3.3724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8503   -4.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5565   -4.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2684   -4.1951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2696   -3.3744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5589   -2.9608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5543   -5.4193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9783   -2.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9750   -4.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9727   -5.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6793   -5.8334    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2639   -5.8295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6770   -6.6506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3836   -7.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3813   -7.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6838   -4.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7201   -3.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2684   -2.6989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8615   -1.9902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0618   -2.1582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7228   -8.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9731   -9.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7904   -9.1391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0449   -8.3626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3904   -4.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3827   -5.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0884   -5.8347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7983   -5.4281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7979   -4.6066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0916   -4.1998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  7 11  2  0
  9 12  1  0
  8 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 13 20  1  0
 12 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 12  1  0
 19 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 19  1  0
 20 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4101171

    ---

Associated Targets(non-human)

Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 454.49Molecular Weight (Monoisotopic): 454.1641AlogP: 4.20#Rotatable Bonds: 7
Polar Surface Area: 100.08Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.23CX Basic pKa: CX LogP: 4.43CX LogD: 4.43
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -1.03

References

1. Khattab SN, Haiba NS, Asal AM, Bekhit AA, Guemei AA, Amer A, El-Faham A..  (2017)  Study of antileishmanial activity of 2-aminobenzoyl amino acid hydrazides and their quinazoline derivatives.,  27  (4): [PMID:28087274] [10.1016/j.bmcl.2017.01.003]

Source