The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-hydroxy-3-methoxyestradiol ID: ALA4101296
Cas Number: 5976-65-8
PubChem CID: 13267935
Max Phase: Preclinical
Molecular Formula: C19H26O3
Molecular Weight: 302.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1O)[C@H]1CC[C@]3(C)[C@@H](O)CC[C@H]3[C@@H]1CC2
Standard InChI: InChI=1S/C19H26O3/c1-19-8-7-12-13(15(19)5-6-18(19)21)4-3-11-9-17(22-2)16(20)10-14(11)12/h9-10,12-13,15,18,20-21H,3-8H2,1-2H3/t12-,13+,15-,18-,19-/m0/s1
Standard InChI Key: MMKYSUOJWFKECQ-SSTWWWIQSA-N
Molfile:
RDKit 2D
25 28 0 0 0 0 0 0 0 0999 V2000
21.3556 -29.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6506 -29.8698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3556 -28.6440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0646 -28.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0646 -29.8698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7737 -29.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4787 -29.8698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1878 -29.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1878 -28.6440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8927 -28.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6741 -28.4901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1542 -27.8269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6741 -27.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9246 -26.3905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8927 -27.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8927 -26.6011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1878 -27.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4787 -27.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4787 -28.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7737 -28.6440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6506 -28.2354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4787 -29.0526 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
24.1878 -27.8269 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
24.8927 -29.0526 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.9422 -29.4624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
3 4 2 0
1 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 1
13 15 1 0
10 15 1 0
15 16 1 1
15 17 1 0
17 18 1 0
18 19 1 0
9 19 1 0
19 20 1 0
4 20 1 0
6 20 2 0
3 21 1 0
19 22 1 6
9 23 1 1
10 24 1 6
2 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 302.41Molecular Weight (Monoisotopic): 302.1882AlogP: 3.62#Rotatable Bonds: 1Polar Surface Area: 49.69Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.32CX Basic pKa: ┄CX LogP: 3.59CX LogD: 3.59Aromatic Rings: 1Heavy Atoms: 22QED Weighted: 0.83Np Likeness Score: 2.17