The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((1-(2-(6,7-Dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)ethyl)-1H-1,2,3-triazol-4-yl)methoxy)-N-(3,4,5-trimethoxyphenyl)benzamide ID: ALA4101419
PubChem CID: 137661238
Max Phase: Preclinical
Molecular Formula: C32H37N5O7
Molecular Weight: 603.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(CCn1cc(COc3ccccc3C(=O)Nc3cc(OC)c(OC)c(OC)c3)nn1)CC2
Standard InChI: InChI=1S/C32H37N5O7/c1-39-27-14-21-10-11-36(18-22(21)15-28(27)40-2)12-13-37-19-24(34-35-37)20-44-26-9-7-6-8-25(26)32(38)33-23-16-29(41-3)31(43-5)30(17-23)42-4/h6-9,14-17,19H,10-13,18,20H2,1-5H3,(H,33,38)
Standard InChI Key: QBQSIAMCKADTSL-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
23.1400 -19.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1388 -20.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8510 -21.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5648 -20.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5619 -19.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8492 -19.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2772 -21.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2785 -21.8833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9843 -20.6523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6968 -21.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2722 -19.4123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9815 -19.8224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6918 -19.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4412 -19.7436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9898 -19.1301 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5744 -18.4198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7716 -18.5928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8081 -19.1297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2163 -18.4176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0376 -18.4172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4473 -19.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2651 -19.1367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4455 -17.7098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2694 -17.7130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6743 -18.4279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4945 -18.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9108 -17.7212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4968 -17.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6779 -17.0054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9099 -16.2940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7321 -17.7235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1387 -18.4365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7313 -16.2945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6934 -21.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4051 -22.2910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1173 -21.8772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1133 -21.0516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4011 -20.6479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8184 -20.6386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8265 -22.2831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4060 -23.1082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5287 -21.0427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8296 -23.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6987 -23.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
5 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 13 1 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 23 1 0
21 22 1 0
22 25 1 0
24 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
28 30 1 0
27 31 1 0
31 32 1 0
30 33 1 0
10 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 10 1 0
37 39 1 0
36 40 1 0
35 41 1 0
39 42 1 0
40 43 1 0
41 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 603.68Molecular Weight (Monoisotopic): 603.2693AlogP: 4.21#Rotatable Bonds: 13Polar Surface Area: 118.43Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.14CX LogP: 3.76CX LogD: 3.56Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.24Np Likeness Score: -1.25
References 1. Pan M, Cui J, Jiao L, Ghaleb H, Liao C, Zhou J, Kairuki M, Lin H, Huang W, Qian H.. (2017) Synthesis and biological evaluation of JL-A7 derivatives as potent ABCB1 inhibitors., 25 (15): [PMID:28645831 ] [10.1016/j.bmc.2017.06.015 ]