(S)-4-benzyl-3-(3-cyclopentylpropyl)-1-(4-((S)-2-propyl-4,5-dihydro-1H-imidazol-4-yl)butyl)imidazolidine-2-thione

ID: ALA4101440

PubChem CID: 137658927

Max Phase: Preclinical

Molecular Formula: C28H44N4S

Molecular Weight: 468.76

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC1=N[C@@H](CCCCN2C[C@H](Cc3ccccc3)N(CCCC3CCCC3)C2=S)CN1

Standard InChI:  InChI=1S/C28H44N4S/c1-2-11-27-29-21-25(30-27)17-8-9-18-31-22-26(20-24-14-4-3-5-15-24)32(28(31)33)19-10-16-23-12-6-7-13-23/h3-5,14-15,23,25-26H,2,6-13,16-22H2,1H3,(H,29,30)/t25-,26-/m0/s1

Standard InChI Key:  PGUIOSMKYOTJKP-UIOOFZCWSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   22.1343   -6.3386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2699   -5.5327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0356   -5.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1712   -4.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9369   -4.1559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1547   -3.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9711   -3.3342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2566   -4.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6166   -4.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6509   -5.4244    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   26.0439   -4.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6273   -3.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4146   -3.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9980   -3.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7853   -3.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0674   -4.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8839   -4.3428    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1031   -3.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4220   -3.1039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6461   -2.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9457   -1.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7549   -1.8508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0546   -1.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5458   -0.4507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7337   -0.5746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4378   -1.3340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8688   -3.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4989   -3.7904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2646   -3.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4043   -6.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5243   -7.5141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3303   -7.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7081   -6.9252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 14  1  6
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
  6 20  1  1
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 18 27  1  0
 27 28  1  0
 28 29  1  0
  1 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33  1  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4101440

    ---

Associated Targets(Human)

RORA Tchem Nuclear receptor ROR-alpha (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorb Nuclear receptor ROR-beta (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.76Molecular Weight (Monoisotopic): 468.3287AlogP: 5.81#Rotatable Bonds: 13
Polar Surface Area: 30.87Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.47CX LogP: 6.23CX LogD: 3.90
Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.29Np Likeness Score: -0.16

References

1. Nefzi A, Marconi GD, Ortiz MA, Davis JC, Piedrafita FJ..  (2017)  Synthesis of dihydroimidazole tethered imidazolinethiones and their activity as novel antagonists of the nuclear retinoic acid receptor-related orphan receptors (RORs).,  27  (7): [PMID:28242276] [10.1016/j.bmcl.2017.02.014]

Source