The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-benzyl-3-(3-cyclopentylpropyl)-1-(4-((S)-2-propyl-4,5-dihydro-1H-imidazol-4-yl)butyl)imidazolidine-2-thione ID: ALA4101440
PubChem CID: 137658927
Max Phase: Preclinical
Molecular Formula: C28H44N4S
Molecular Weight: 468.76
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC1=N[C@@H](CCCCN2C[C@H](Cc3ccccc3)N(CCCC3CCCC3)C2=S)CN1
Standard InChI: InChI=1S/C28H44N4S/c1-2-11-27-29-21-25(30-27)17-8-9-18-31-22-26(20-24-14-4-3-5-15-24)32(28(31)33)19-10-16-23-12-6-7-13-23/h3-5,14-15,23,25-26H,2,6-13,16-22H2,1H3,(H,29,30)/t25-,26-/m0/s1
Standard InChI Key: PGUIOSMKYOTJKP-UIOOFZCWSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
22.1343 -6.3386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2699 -5.5327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0356 -5.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1712 -4.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9369 -4.1559 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1547 -3.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9711 -3.3342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2566 -4.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6166 -4.6080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6509 -5.4244 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.0439 -4.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6273 -3.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4146 -3.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9980 -3.3939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7853 -3.6131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0674 -4.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8839 -4.3428 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.1031 -3.5555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4220 -3.1039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6461 -2.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9457 -1.9692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7549 -1.8508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0546 -1.0913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5458 -0.4507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7337 -0.5746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4378 -1.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8688 -3.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4989 -3.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2646 -3.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4043 -6.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5243 -7.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3303 -7.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7081 -6.9252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 2 0
8 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
15 14 1 6
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
6 20 1 1
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
18 27 1 0
27 28 1 0
28 29 1 0
1 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 1 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.76Molecular Weight (Monoisotopic): 468.3287AlogP: 5.81#Rotatable Bonds: 13Polar Surface Area: 30.87Molecular Species: BASEHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.47CX LogP: 6.23CX LogD: 3.90Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.29Np Likeness Score: -0.16
References 1. Nefzi A, Marconi GD, Ortiz MA, Davis JC, Piedrafita FJ.. (2017) Synthesis of dihydroimidazole tethered imidazolinethiones and their activity as novel antagonists of the nuclear retinoic acid receptor-related orphan receptors (RORs)., 27 (7): [PMID:28242276 ] [10.1016/j.bmcl.2017.02.014 ]