4-Methyl-2-oxo-2H-chromene-7,8-diyl bis(4-propyl benzenesulfonate)

ID: ALA4101742

PubChem CID: 137661251

Max Phase: Preclinical

Molecular Formula: C28H28O8S2

Molecular Weight: 556.66

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCc1ccc(S(=O)(=O)Oc2ccc3c(C)cc(=O)oc3c2OS(=O)(=O)c2ccc(CCC)cc2)cc1

Standard InChI:  InChI=1S/C28H28O8S2/c1-4-6-20-8-12-22(13-9-20)37(30,31)35-25-17-16-24-19(3)18-26(29)34-27(24)28(25)36-38(32,33)23-14-10-21(7-5-2)11-15-23/h8-18H,4-7H2,1-3H3

Standard InChI Key:  NNBIFSZWBYQILY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   16.0797  -17.9204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8969  -17.9246    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.4919  -17.2148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0685  -15.5803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4812  -16.2902    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.8897  -15.5778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8996  -15.4729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8984  -16.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6065  -16.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6047  -15.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3133  -15.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3167  -16.2900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0251  -16.6951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7348  -16.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7314  -15.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0184  -15.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0139  -14.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4436  -16.6908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1904  -16.7005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7750  -16.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0682  -16.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3625  -16.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3633  -17.5158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0758  -17.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7786  -17.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6070  -17.5186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9001  -18.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1935  -19.1513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1937  -19.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9022  -20.3767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6120  -19.9632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6083  -19.1481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6568  -17.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9479  -17.5199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2414  -17.9306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9039  -21.1939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1970  -21.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1986  -22.4211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 14 18  2  0
  8 19  1  0
 19  5  1  0
  5 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  9 26  1  0
 26  2  1  0
  2 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 23 33  1  0
 33 34  1  0
 34 35  1  0
 30 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4101742

    ---

Associated Targets(Human)

ALPL Tchem Alkaline phosphatase, tissue-nonspecific isozyme (1551 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALPI Tchem Intestinal alkaline phosphatase (724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.66Molecular Weight (Monoisotopic): 556.1226AlogP: 5.54#Rotatable Bonds: 10
Polar Surface Area: 116.95Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 7.32CX LogD: 7.32
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: -0.14

References

1. Salar U, Khan KM, Iqbal J, Ejaz SA, Hameed A, Al-Rashida M, Perveen S, Tahir MN..  (2017)  Coumarin sulfonates: New alkaline phosphatase inhibitors; in vitro and in silico studies.,  131  [PMID:28288318] [10.1016/j.ejmech.2017.03.003]

Source