The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-(3-chlorophenyl)(6-isopropoxy-1-((4-methoxyphenoxy)methyl)-3,4-dihydroisoquinolin-2(1H)-yl)methanethione ID: ALA4101985
PubChem CID: 137661532
Max Phase: Preclinical
Molecular Formula: C27H28ClNO3S
Molecular Weight: 482.05
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(OC[C@H]2c3ccc(OC(C)C)cc3CCN2C(=S)c2cccc(Cl)c2)cc1
Standard InChI: InChI=1S/C27H28ClNO3S/c1-18(2)32-24-11-12-25-19(16-24)13-14-29(27(33)20-5-4-6-21(28)15-20)26(25)17-31-23-9-7-22(30-3)8-10-23/h4-12,15-16,18,26H,13-14,17H2,1-3H3/t26-/m0/s1
Standard InChI Key: UDKWTIUVZOIYNA-SANMLTNESA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
6.3174 -7.3217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3162 -8.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0243 -8.5502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0225 -6.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7311 -7.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7299 -8.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4361 -8.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1480 -8.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1492 -7.3201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4385 -6.9065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8579 -6.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5646 -7.3235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8598 -6.0960 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5610 -8.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2669 -8.5502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9765 -8.1433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9759 -7.3218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2694 -6.9153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4385 -6.0893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7308 -5.6807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7308 -4.8635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4397 -4.4580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4400 -3.6415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7318 -3.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0217 -3.6451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0249 -4.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6082 -8.5492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9008 -8.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6831 -6.9124 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.9015 -7.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1928 -8.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7307 -2.4149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4379 -2.0054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
11 12 1 0
11 13 2 0
12 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 12 1 0
10 19 1 6
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
2 27 1 0
27 28 1 0
17 29 1 0
28 30 1 0
28 31 1 0
24 32 1 0
32 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.05Molecular Weight (Monoisotopic): 481.1478AlogP: 6.49#Rotatable Bonds: 7Polar Surface Area: 30.93Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.69CX LogD: 6.69Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -0.85
References 1. Strong KL, Epplin MP, Bacsa J, Butch CJ, Burger PB, Menaldino DS, Traynelis SF, Liotta DC.. (2017) The Structure-Activity Relationship of a Tetrahydroisoquinoline Class of N-Methyl-d-Aspartate Receptor Modulators that Potentiates GluN2B-Containing N-Methyl-d-Aspartate Receptors., 60 (13): [PMID:28586221 ] [10.1021/acs.jmedchem.7b00239 ]