N-(2-(2-Methoxyquinolin-8-yl)ethyl)acetamide

ID: ALA4102177

PubChem CID: 137660333

Max Phase: Preclinical

Molecular Formula: C14H16N2O2

Molecular Weight: 244.29

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2cccc(CCNC(C)=O)c2n1

Standard InChI:  InChI=1S/C14H16N2O2/c1-10(17)15-9-8-12-5-3-4-11-6-7-13(18-2)16-14(11)12/h3-7H,8-9H2,1-2H3,(H,15,17)

Standard InChI Key:  JOEAUASPZYBRHH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 18 19  0  0  0  0  0  0  0  0999 V2000
    4.8533  -19.4502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5630  -19.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5602  -18.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8516  -17.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1453  -19.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1476  -18.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4416  -17.8144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7330  -18.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7346  -19.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4412  -19.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0252  -17.8135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0250  -16.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8481  -16.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5540  -16.5840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5505  -15.7668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2565  -15.3552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2530  -14.5380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9659  -15.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  8 11  1  0
 11 12  1  0
  4 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4102177

    ---

Associated Targets(Human)

MTNR1B Tclin Melatonin receptor 1B (2168 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MTNR1A Tclin Melatonin receptor 1A (2519 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 244.29Molecular Weight (Monoisotopic): 244.1212AlogP: 1.92#Rotatable Bonds: 4
Polar Surface Area: 51.22Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.13CX LogP: 1.80CX LogD: 1.80
Aromatic Rings: 2Heavy Atoms: 18QED Weighted: 0.89Np Likeness Score: -1.20

References

1. Landagaray E, Ettaoussi M, Rami M, Boutin JA, Caignard DH, Delagrange P, Melnyk P, Berthelot P, Yous S..  (2017)  New quinolinic derivatives as melatonergic ligands: Synthesis and pharmacological evaluation.,  127  [PMID:28131094] [10.1016/j.ejmech.2016.12.013]

Source